C31H38O8 — CID 118720044
[(1S,2S,3aR,5S,6E,13R,13aR)-3a,13-diacetyloxy-2,5,8,8-tetramethyl-12-methylidene-4,9-dioxo-1,2,3,5,10,11,13,13a-octahydrocyclopenta[12]annulen-1-yl] benzoate (PubChem CID 118720044) has the molecular formula C31H38O8 and a molecular weight of 538.64 g/mol. Its IUPAC name is [(1S,2S,3aR,5S,6E,13R,13aR)-3a,13-diacetyloxy-2,5,8,8-tetramethyl-12-methylidene-4,9-dioxo-1,2,3,5,10,11,13,13a-octahydrocyclopenta[12]annulen-1-yl] benzoate.
| Compound Name | [(1S,2S,3aR,5S,6E,13R,13aR)-3a,13-diacetyloxy-2,5,8,8-tetramethyl-12-methylidene-4,9-dioxo-1,2,3,5,10,11,13,13a-octahydrocyclopenta[12]annulen-1-yl] benzoate |
|---|---|
| PubChem CID | 118720044 |
| Molecular Formula | C31H38O8 |
| Molecular Weight | 538.64 g/mol |
| Exact Mass | 538.26 |
| IUPAC Name | [(1S,2S,3aR,5S,6E,13R,13aR)-3a,13-diacetyloxy-2,5,8,8-tetramethyl-12-methylidene-4,9-dioxo-1,2,3,5,10,11,13,13a-octahydrocyclopenta[12]annulen-1-yl] benzoate |
| SMILES | C=C1CCC(=O)C(C)(C)/C=C/[C@H](C)C(=O)[C@@]2(OC(C)=O)C[C@H](C)[C@H](OC(=O)c3ccccc3)[C@@H]2[C@H]1OC(C)=O |
| InChI | InChI=1S/C31H38O8/c1-18-13-14-24(34)30(6,7)16-15-19(2)28(35)31(39-22(5)33)17-20(3)27(25(31)26(18)37-21(4)32)38-29(36)23-11-9-8-10-12-23/h8-12,15-16,19-20,25-27H,1,13-14,17H2,2-7H3/b16-15+/t19-,20-,25-,26-,27-,31+/m0/s1 |
| InChIKey | AFISOGZFAVCZMD-WNRYSBCWSA-N |
| XLogP | 4.81 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.64 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|