About N-[[1-[2,8-bis(trifluoromethyl)quinolin-4-yl]triazol-4-yl]methyl]adamantan-2-amine
N-[[1-[2,8-bis(trifluoromethyl)quinolin-4-yl]triazol-4-yl]methyl]adamantan-2-amine (PubChem CID 118720086) has the molecular formula C24H23F6N5
and a molecular weight of 495.47 g/mol. Its IUPAC name is N-[[1-[2,8-bis(trifluoromethyl)quinolin-4-yl]triazol-4-yl]methyl]adamantan-2-amine.
Molecular Properties
| Compound Name | N-[[1-[2,8-bis(trifluoromethyl)quinolin-4-yl]triazol-4-yl]methyl]adamantan-2-amine |
| PubChem CID | 118720086 |
| Molecular Formula | C24H23F6N5 |
| Molecular Weight | 495.47 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | N-[[1-[2,8-bis(trifluoromethyl)quinolin-4-yl]triazol-4-yl]methyl]adamantan-2-amine |
| SMILES | FC(F)(F)c1cc(-n2cc(CNC3C4CC5CC(C4)CC3C5)nn2)c2cccc(C(F)(F)F)c2n1 |
| InChI | InChI=1S/C24H23F6N5/c25-23(26,27)18-3-1-2-17-19(9-20(24(28,29)30)32-22(17)18)35-11-16(33-34-35)10-31-21-14-5-12-4-13(7-14)8-15(21)6-12/h1-3,9,11-15,21,31H,4-8,10H2 |
| InChIKey | JAUKUAYPRXIRRU-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 495.47 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[[1-[2,8-bis(trifluoromethyl)quinolin-4-yl]triazol-4-yl]methyl]adamantan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[1-[2,8-bis(trifluoromethyl)quinolin-4-yl]triazol-4-yl]methyl]adamantan-2-amine?
The IUPAC name of N-[[1-[2,8-bis(trifluoromethyl)quinolin-4-yl]triazol-4-yl]methyl]adamantan-2-amine (CID 118720086) is N-[[1-[2,8-bis(trifluoromethyl)quinolin-4-yl]triazol-4-yl]methyl]adamantan-2-amine.
What is the SMILES notation for N-[[1-[2,8-bis(trifluoromethyl)quinolin-4-yl]triazol-4-yl]methyl]adamantan-2-amine?
The canonical SMILES for N-[[1-[2,8-bis(trifluoromethyl)quinolin-4-yl]triazol-4-yl]methyl]adamantan-2-amine is FC(F)(F)c1cc(-n2cc(CNC3C4CC5CC(C4)CC3C5)nn2)c2cccc(C(F)(F)F)c2n1.
What is the InChIKey of N-[[1-[2,8-bis(trifluoromethyl)quinolin-4-yl]triazol-4-yl]methyl]adamantan-2-amine?
The InChIKey is JAUKUAYPRXIRRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H23F6N5/c25-23(26,27)18-3-1-2-17-19(9-20(24(28,29)30)32-22(17)18)35-11-16(33-34-35)10-31-21-14-5-12-4-13(7-14)8-15(21)6-12/h1-3,9,11-15,21,31H,4-8,10H2.
What are the key properties of N-[[1-[2,8-bis(trifluoromethyl)quinolin-4-yl]triazol-4-yl]methyl]adamantan-2-amine?
N-[[1-[2,8-bis(trifluoromethyl)quinolin-4-yl]triazol-4-yl]methyl]adamantan-2-amine has a molecular weight of 495.47 g/mol, XLogP of 5.77, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[1-[2,8-bis(trifluoromethyl)quinolin-4-yl]triazol-4-yl]methyl]adamantan-2-amine is sourced from PubChem (CID 118720086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).