About 2-[(3-chlorophenyl)sulfonylmethyl]-4-(2-chloro-4-pyridinyl)thieno[3,2-d]pyrimidine
2-[(3-chlorophenyl)sulfonylmethyl]-4-(2-chloro-4-pyridinyl)thieno[3,2-d]pyrimidine (PubChem CID 118720100) has the molecular formula C18H11Cl2N3O2S2
and a molecular weight of 436.35 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)sulfonylmethyl]-4-(2-chloro-4-pyridinyl)thieno[3,2-d]pyrimidine.
Molecular Properties
| Compound Name | 2-[(3-chlorophenyl)sulfonylmethyl]-4-(2-chloro-4-pyridinyl)thieno[3,2-d]pyrimidine |
| PubChem CID | 118720100 |
| Molecular Formula | C18H11Cl2N3O2S2 |
| Molecular Weight | 436.35 g/mol |
| Exact Mass | 434.97 |
| IUPAC Name | 2-[(3-chlorophenyl)sulfonylmethyl]-4-(2-chloro-4-pyridinyl)thieno[3,2-d]pyrimidine |
| SMILES | O=S(=O)(Cc1nc(-c2ccnc(Cl)c2)c2sccc2n1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H11Cl2N3O2S2/c19-12-2-1-3-13(9-12)27(24,25)10-16-22-14-5-7-26-18(14)17(23-16)11-4-6-21-15(20)8-11/h1-9H,10H2 |
| InChIKey | DTUHAEMVZKFCOV-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 72.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 436.35 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3-chlorophenyl)sulfonylmethyl]-4-(2-chloro-4-pyridinyl)thieno[3,2-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3-chlorophenyl)sulfonylmethyl]-4-(2-chloro-4-pyridinyl)thieno[3,2-d]pyrimidine?
The IUPAC name of 2-[(3-chlorophenyl)sulfonylmethyl]-4-(2-chloro-4-pyridinyl)thieno[3,2-d]pyrimidine (CID 118720100) is 2-[(3-chlorophenyl)sulfonylmethyl]-4-(2-chloro-4-pyridinyl)thieno[3,2-d]pyrimidine.
What is the SMILES notation for 2-[(3-chlorophenyl)sulfonylmethyl]-4-(2-chloro-4-pyridinyl)thieno[3,2-d]pyrimidine?
The canonical SMILES for 2-[(3-chlorophenyl)sulfonylmethyl]-4-(2-chloro-4-pyridinyl)thieno[3,2-d]pyrimidine is O=S(=O)(Cc1nc(-c2ccnc(Cl)c2)c2sccc2n1)c1cccc(Cl)c1.
What is the InChIKey of 2-[(3-chlorophenyl)sulfonylmethyl]-4-(2-chloro-4-pyridinyl)thieno[3,2-d]pyrimidine?
The InChIKey is DTUHAEMVZKFCOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11Cl2N3O2S2/c19-12-2-1-3-13(9-12)27(24,25)10-16-22-14-5-7-26-18(14)17(23-16)11-4-6-21-15(20)8-11/h1-9H,10H2.
What are the key properties of 2-[(3-chlorophenyl)sulfonylmethyl]-4-(2-chloro-4-pyridinyl)thieno[3,2-d]pyrimidine?
2-[(3-chlorophenyl)sulfonylmethyl]-4-(2-chloro-4-pyridinyl)thieno[3,2-d]pyrimidine has a molecular weight of 436.35 g/mol, XLogP of 5.03, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3-chlorophenyl)sulfonylmethyl]-4-(2-chloro-4-pyridinyl)thieno[3,2-d]pyrimidine is sourced from PubChem (CID 118720100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).