About 2,2,2-trifluoroethyl 2-[4-[2-(diethylamino)-2-oxoethoxy]-2-fluoro-5-methoxyphenyl]acetate
2,2,2-trifluoroethyl 2-[4-[2-(diethylamino)-2-oxoethoxy]-2-fluoro-5-methoxyphenyl]acetate (PubChem CID 118720114) has the molecular formula C17H21F4NO5
and a molecular weight of 395.35 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 2-[4-[2-(diethylamino)-2-oxoethoxy]-2-fluoro-5-methoxyphenyl]acetate.
Molecular Properties
| Compound Name | 2,2,2-trifluoroethyl 2-[4-[2-(diethylamino)-2-oxoethoxy]-2-fluoro-5-methoxyphenyl]acetate |
| PubChem CID | 118720114 |
| Molecular Formula | C17H21F4NO5 |
| Molecular Weight | 395.35 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | 2,2,2-trifluoroethyl 2-[4-[2-(diethylamino)-2-oxoethoxy]-2-fluoro-5-methoxyphenyl]acetate |
| SMILES | CCN(CC)C(=O)COc1cc(F)c(CC(=O)OCC(F)(F)F)cc1OC |
| InChI | InChI=1S/C17H21F4NO5/c1-4-22(5-2)15(23)9-26-14-8-12(18)11(6-13(14)25-3)7-16(24)27-10-17(19,20)21/h6,8H,4-5,7,9-10H2,1-3H3 |
| InChIKey | FRWFTVGLEZPIDD-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.35 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2,2,2-trifluoroethyl 2-[4-[2-(diethylamino)-2-oxoethoxy]-2-fluoro-5-methoxyphenyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,2-trifluoroethyl 2-[4-[2-(diethylamino)-2-oxoethoxy]-2-fluoro-5-methoxyphenyl]acetate?
The IUPAC name of 2,2,2-trifluoroethyl 2-[4-[2-(diethylamino)-2-oxoethoxy]-2-fluoro-5-methoxyphenyl]acetate (CID 118720114) is 2,2,2-trifluoroethyl 2-[4-[2-(diethylamino)-2-oxoethoxy]-2-fluoro-5-methoxyphenyl]acetate.
What is the SMILES notation for 2,2,2-trifluoroethyl 2-[4-[2-(diethylamino)-2-oxoethoxy]-2-fluoro-5-methoxyphenyl]acetate?
The canonical SMILES for 2,2,2-trifluoroethyl 2-[4-[2-(diethylamino)-2-oxoethoxy]-2-fluoro-5-methoxyphenyl]acetate is CCN(CC)C(=O)COc1cc(F)c(CC(=O)OCC(F)(F)F)cc1OC.
What is the InChIKey of 2,2,2-trifluoroethyl 2-[4-[2-(diethylamino)-2-oxoethoxy]-2-fluoro-5-methoxyphenyl]acetate?
The InChIKey is FRWFTVGLEZPIDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21F4NO5/c1-4-22(5-2)15(23)9-26-14-8-12(18)11(6-13(14)25-3)7-16(24)27-10-17(19,20)21/h6,8H,4-5,7,9-10H2,1-3H3.
What are the key properties of 2,2,2-trifluoroethyl 2-[4-[2-(diethylamino)-2-oxoethoxy]-2-fluoro-5-methoxyphenyl]acetate?
2,2,2-trifluoroethyl 2-[4-[2-(diethylamino)-2-oxoethoxy]-2-fluoro-5-methoxyphenyl]acetate has a molecular weight of 395.35 g/mol, XLogP of 2.73, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,2-trifluoroethyl 2-[4-[2-(diethylamino)-2-oxoethoxy]-2-fluoro-5-methoxyphenyl]acetate is sourced from PubChem (CID 118720114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).