C24H20FNO7 — CID 118720188
2-(3,4-dihydroxyphenyl)-8-[[2-(3-fluorophenyl)ethylamino]methyl]-3,5,7-trihydroxychromen-4-one (PubChem CID 118720188) has the molecular formula C24H20FNO7 and a molecular weight of 453.42 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)-8-[[2-(3-fluorophenyl)ethylamino]methyl]-3,5,7-trihydroxychromen-4-one.
| Compound Name | 2-(3,4-dihydroxyphenyl)-8-[[2-(3-fluorophenyl)ethylamino]methyl]-3,5,7-trihydroxychromen-4-one |
|---|---|
| PubChem CID | 118720188 |
| Molecular Formula | C24H20FNO7 |
| Molecular Weight | 453.42 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-8-[[2-(3-fluorophenyl)ethylamino]methyl]-3,5,7-trihydroxychromen-4-one |
| SMILES | O=c1c(O)c(-c2ccc(O)c(O)c2)oc2c(CNCCc3cccc(F)c3)c(O)cc(O)c12 |
| InChI | InChI=1S/C24H20FNO7/c25-14-3-1-2-12(8-14)6-7-26-11-15-17(28)10-19(30)20-21(31)22(32)23(33-24(15)20)13-4-5-16(27)18(29)9-13/h1-5,8-10,26-30,32H,6-7,11H2 |
| InChIKey | YQOLTKHWGNJSMF-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 143.39 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.42 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|