About N-(4-cyclohexyloxy-3-pyridinyl)-2-(2,6-difluorophenyl)-1,3-thiazole-4-carboxamide
N-(4-cyclohexyloxy-3-pyridinyl)-2-(2,6-difluorophenyl)-1,3-thiazole-4-carboxamide (PubChem CID 118720249) has the molecular formula C21H19F2N3O2S
and a molecular weight of 415.47 g/mol. Its IUPAC name is N-(4-cyclohexyloxy-3-pyridinyl)-2-(2,6-difluorophenyl)-1,3-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | N-(4-cyclohexyloxy-3-pyridinyl)-2-(2,6-difluorophenyl)-1,3-thiazole-4-carboxamide |
| PubChem CID | 118720249 |
| Molecular Formula | C21H19F2N3O2S |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | N-(4-cyclohexyloxy-3-pyridinyl)-2-(2,6-difluorophenyl)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1cnccc1OC1CCCCC1)c1csc(-c2c(F)cccc2F)n1 |
| InChI | InChI=1S/C21H19F2N3O2S/c22-14-7-4-8-15(23)19(14)21-26-17(12-29-21)20(27)25-16-11-24-10-9-18(16)28-13-5-2-1-3-6-13/h4,7-13H,1-3,5-6H2,(H,25,27) |
| InChIKey | QVAKUYTZVMRSAG-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(4-cyclohexyloxy-3-pyridinyl)-2-(2,6-difluorophenyl)-1,3-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-cyclohexyloxy-3-pyridinyl)-2-(2,6-difluorophenyl)-1,3-thiazole-4-carboxamide?
The IUPAC name of N-(4-cyclohexyloxy-3-pyridinyl)-2-(2,6-difluorophenyl)-1,3-thiazole-4-carboxamide (CID 118720249) is N-(4-cyclohexyloxy-3-pyridinyl)-2-(2,6-difluorophenyl)-1,3-thiazole-4-carboxamide.
What is the SMILES notation for N-(4-cyclohexyloxy-3-pyridinyl)-2-(2,6-difluorophenyl)-1,3-thiazole-4-carboxamide?
The canonical SMILES for N-(4-cyclohexyloxy-3-pyridinyl)-2-(2,6-difluorophenyl)-1,3-thiazole-4-carboxamide is O=C(Nc1cnccc1OC1CCCCC1)c1csc(-c2c(F)cccc2F)n1.
What is the InChIKey of N-(4-cyclohexyloxy-3-pyridinyl)-2-(2,6-difluorophenyl)-1,3-thiazole-4-carboxamide?
The InChIKey is QVAKUYTZVMRSAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19F2N3O2S/c22-14-7-4-8-15(23)19(14)21-26-17(12-29-21)20(27)25-16-11-24-10-9-18(16)28-13-5-2-1-3-6-13/h4,7-13H,1-3,5-6H2,(H,25,27).
What are the key properties of N-(4-cyclohexyloxy-3-pyridinyl)-2-(2,6-difluorophenyl)-1,3-thiazole-4-carboxamide?
N-(4-cyclohexyloxy-3-pyridinyl)-2-(2,6-difluorophenyl)-1,3-thiazole-4-carboxamide has a molecular weight of 415.47 g/mol, XLogP of 5.45, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-cyclohexyloxy-3-pyridinyl)-2-(2,6-difluorophenyl)-1,3-thiazole-4-carboxamide is sourced from PubChem (CID 118720249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).