C24H31F2NO5 — CID 118720308
(2S,3R,4R,5S)-1-[4,4-difluoro-5-[(4-phenylphenyl)methoxy]pentyl]-2-(hydroxymethyl)piperidine-3,4,5-triol (PubChem CID 118720308) has the molecular formula C24H31F2NO5 and a molecular weight of 451.51 g/mol. Its IUPAC name is (2S,3R,4R,5S)-1-[4,4-difluoro-5-[(4-phenylphenyl)methoxy]pentyl]-2-(hydroxymethyl)piperidine-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S)-1-[4,4-difluoro-5-[(4-phenylphenyl)methoxy]pentyl]-2-(hydroxymethyl)piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 118720308 |
| Molecular Formula | C24H31F2NO5 |
| Molecular Weight | 451.51 g/mol |
| Exact Mass | 451.22 |
| IUPAC Name | (2S,3R,4R,5S)-1-[4,4-difluoro-5-[(4-phenylphenyl)methoxy]pentyl]-2-(hydroxymethyl)piperidine-3,4,5-triol |
| SMILES | OC[C@H]1[C@@H](O)[C@H](O)[C@@H](O)CN1CCCC(F)(F)COCc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H31F2NO5/c25-24(26,11-4-12-27-13-21(29)23(31)22(30)20(27)14-28)16-32-15-17-7-9-19(10-8-17)18-5-2-1-3-6-18/h1-3,5-10,20-23,28-31H,4,11-16H2/t20-,21-,22+,23+/m0/s1 |
| InChIKey | MGIKPOPLRLHKKL-MYDTUXCISA-N |
| XLogP | 2.04 |
| TPSA | 93.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.51 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |