About 2-[(2,4-difluorophenyl)sulfanylmethyl]-4-(6-methoxy-3-pyridinyl)thieno[3,2-d]pyrimidine
2-[(2,4-difluorophenyl)sulfanylmethyl]-4-(6-methoxy-3-pyridinyl)thieno[3,2-d]pyrimidine (PubChem CID 118720399) has the molecular formula C19H13F2N3OS2
and a molecular weight of 401.46 g/mol. Its IUPAC name is 2-[(2,4-difluorophenyl)sulfanylmethyl]-4-(6-methoxy-3-pyridinyl)thieno[3,2-d]pyrimidine.
Molecular Properties
| Compound Name | 2-[(2,4-difluorophenyl)sulfanylmethyl]-4-(6-methoxy-3-pyridinyl)thieno[3,2-d]pyrimidine |
| PubChem CID | 118720399 |
| Molecular Formula | C19H13F2N3OS2 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.05 |
| IUPAC Name | 2-[(2,4-difluorophenyl)sulfanylmethyl]-4-(6-methoxy-3-pyridinyl)thieno[3,2-d]pyrimidine |
| SMILES | COc1ccc(-c2nc(CSc3ccc(F)cc3F)nc3ccsc23)cn1 |
| InChI | InChI=1S/C19H13F2N3OS2/c1-25-17-5-2-11(9-22-17)18-19-14(6-7-26-19)23-16(24-18)10-27-15-4-3-12(20)8-13(15)21/h2-9H,10H2,1H3 |
| InChIKey | ZTBJMUIWPATAJP-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(2,4-difluorophenyl)sulfanylmethyl]-4-(6-methoxy-3-pyridinyl)thieno[3,2-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,4-difluorophenyl)sulfanylmethyl]-4-(6-methoxy-3-pyridinyl)thieno[3,2-d]pyrimidine?
The IUPAC name of 2-[(2,4-difluorophenyl)sulfanylmethyl]-4-(6-methoxy-3-pyridinyl)thieno[3,2-d]pyrimidine (CID 118720399) is 2-[(2,4-difluorophenyl)sulfanylmethyl]-4-(6-methoxy-3-pyridinyl)thieno[3,2-d]pyrimidine.
What is the SMILES notation for 2-[(2,4-difluorophenyl)sulfanylmethyl]-4-(6-methoxy-3-pyridinyl)thieno[3,2-d]pyrimidine?
The canonical SMILES for 2-[(2,4-difluorophenyl)sulfanylmethyl]-4-(6-methoxy-3-pyridinyl)thieno[3,2-d]pyrimidine is COc1ccc(-c2nc(CSc3ccc(F)cc3F)nc3ccsc23)cn1.
What is the InChIKey of 2-[(2,4-difluorophenyl)sulfanylmethyl]-4-(6-methoxy-3-pyridinyl)thieno[3,2-d]pyrimidine?
The InChIKey is ZTBJMUIWPATAJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13F2N3OS2/c1-25-17-5-2-11(9-22-17)18-19-14(6-7-26-19)23-16(24-18)10-27-15-4-3-12(20)8-13(15)21/h2-9H,10H2,1H3.
What are the key properties of 2-[(2,4-difluorophenyl)sulfanylmethyl]-4-(6-methoxy-3-pyridinyl)thieno[3,2-d]pyrimidine?
2-[(2,4-difluorophenyl)sulfanylmethyl]-4-(6-methoxy-3-pyridinyl)thieno[3,2-d]pyrimidine has a molecular weight of 401.46 g/mol, XLogP of 5.33, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,4-difluorophenyl)sulfanylmethyl]-4-(6-methoxy-3-pyridinyl)thieno[3,2-d]pyrimidine is sourced from PubChem (CID 118720399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).