C26H22F3N3O2 — CID 118720405
ethyl (3R)-3-benzyl-10-[4-(trifluoromethyl)phenyl]-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-3-carboxylate (PubChem CID 118720405) has the molecular formula C26H22F3N3O2 and a molecular weight of 465.48 g/mol. Its IUPAC name is ethyl (3R)-3-benzyl-10-[4-(trifluoromethyl)phenyl]-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-3-carboxylate.
| Compound Name | ethyl (3R)-3-benzyl-10-[4-(trifluoromethyl)phenyl]-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-3-carboxylate |
|---|---|
| PubChem CID | 118720405 |
| Molecular Formula | C26H22F3N3O2 |
| Molecular Weight | 465.48 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | ethyl (3R)-3-benzyl-10-[4-(trifluoromethyl)phenyl]-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-3-carboxylate |
| SMILES | CCOC(=O)[C@@]1(Cc2ccccc2)CCc2cnc3c(-c4ccc(C(F)(F)F)cc4)cnn3c21 |
| InChI | InChI=1S/C26H22F3N3O2/c1-2-34-24(33)25(14-17-6-4-3-5-7-17)13-12-19-15-30-23-21(16-31-32(23)22(19)25)18-8-10-20(11-9-18)26(27,28)29/h3-11,15-16H,2,12-14H2,1H3/t25-/m1/s1 |
| InChIKey | QGPDNTVBBFWXKO-RUZDIDTESA-N |
| XLogP | 5.40 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.48 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |