C25H21F3N4O2 — CID 118720417
ethyl (3S)-3-benzyl-10-[4-(trifluoromethyl)phenyl]-1,5,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-3-carboxylate (PubChem CID 118720417) has the molecular formula C25H21F3N4O2 and a molecular weight of 466.46 g/mol. Its IUPAC name is ethyl (3S)-3-benzyl-10-[4-(trifluoromethyl)phenyl]-1,5,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-3-carboxylate.
| Compound Name | ethyl (3S)-3-benzyl-10-[4-(trifluoromethyl)phenyl]-1,5,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-3-carboxylate |
|---|---|
| PubChem CID | 118720417 |
| Molecular Formula | C25H21F3N4O2 |
| Molecular Weight | 466.46 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | ethyl (3S)-3-benzyl-10-[4-(trifluoromethyl)phenyl]-1,5,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-3-carboxylate |
| SMILES | CCOC(=O)[C@@]1(Cc2ccccc2)CNc2cnc3c(-c4ccc(C(F)(F)F)cc4)cnn3c21 |
| InChI | InChI=1S/C25H21F3N4O2/c1-2-34-23(33)24(12-16-6-4-3-5-7-16)15-30-20-14-29-22-19(13-31-32(22)21(20)24)17-8-10-18(11-9-17)25(26,27)28/h3-11,13-14,30H,2,12,15H2,1H3/t24-/m0/s1 |
| InChIKey | PHRLNUFPRBBYSI-DEOSSOPVSA-N |
| XLogP | 4.88 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.46 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |