C26H23F3N4O2 — CID 118720420
ethyl 3-benzyl-4-methyl-10-[4-(trifluoromethyl)phenyl]-1,4,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-3-carboxylate (PubChem CID 118720420) has the molecular formula C26H23F3N4O2 and a molecular weight of 480.49 g/mol. Its IUPAC name is ethyl 3-benzyl-4-methyl-10-[4-(trifluoromethyl)phenyl]-1,4,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-3-carboxylate.
| Compound Name | ethyl 3-benzyl-4-methyl-10-[4-(trifluoromethyl)phenyl]-1,4,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-3-carboxylate |
|---|---|
| PubChem CID | 118720420 |
| Molecular Formula | C26H23F3N4O2 |
| Molecular Weight | 480.49 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | ethyl 3-benzyl-4-methyl-10-[4-(trifluoromethyl)phenyl]-1,4,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-3-carboxylate |
| SMILES | CCOC(=O)C1(Cc2ccccc2)c2c(cnc3c(-c4ccc(C(F)(F)F)cc4)cnn23)CN1C |
| InChI | InChI=1S/C26H23F3N4O2/c1-3-35-24(34)25(13-17-7-5-4-6-8-17)22-19(16-32(25)2)14-30-23-21(15-31-33(22)23)18-9-11-20(12-10-18)26(27,28)29/h4-12,14-15H,3,13,16H2,1-2H3 |
| InChIKey | XCEHXJCCOGXTBG-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.49 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |