C24H30N2O4 — CID 118720492
2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-N-(5-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)acetamide (PubChem CID 118720492) has the molecular formula C24H30N2O4 and a molecular weight of 410.51 g/mol. Its IUPAC name is 2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-N-(5-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)acetamide.
| Compound Name | 2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-N-(5-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)acetamide |
|---|---|
| PubChem CID | 118720492 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | 2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-N-(5-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)acetamide |
| SMILES | COc1cc2c(cc1OC)CN(CC(=O)NC1CCCc3c(OC)cccc31)CC2 |
| InChI | InChI=1S/C24H30N2O4/c1-28-21-9-5-6-18-19(21)7-4-8-20(18)25-24(27)15-26-11-10-16-12-22(29-2)23(30-3)13-17(16)14-26/h5-6,9,12-13,20H,4,7-8,10-11,14-15H2,1-3H3,(H,25,27) |
| InChIKey | XMRRSJYVQYHFOP-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |