About 2-[4-[1-(4-fluorophenyl)indol-3-yl]butyl]-6,7-dimethoxy-3,4-dihydroisoquinolin-1-one
2-[4-[1-(4-fluorophenyl)indol-3-yl]butyl]-6,7-dimethoxy-3,4-dihydroisoquinolin-1-one (PubChem CID 118720496) has the molecular formula C29H29FN2O3
and a molecular weight of 472.56 g/mol. Its IUPAC name is 2-[4-[1-(4-fluorophenyl)indol-3-yl]butyl]-6,7-dimethoxy-3,4-dihydroisoquinolin-1-one.
Molecular Properties
| Compound Name | 2-[4-[1-(4-fluorophenyl)indol-3-yl]butyl]-6,7-dimethoxy-3,4-dihydroisoquinolin-1-one |
| PubChem CID | 118720496 |
| Molecular Formula | C29H29FN2O3 |
| Molecular Weight | 472.56 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | 2-[4-[1-(4-fluorophenyl)indol-3-yl]butyl]-6,7-dimethoxy-3,4-dihydroisoquinolin-1-one |
| SMILES | COc1cc2c(cc1OC)C(=O)N(CCCCc1cn(-c3ccc(F)cc3)c3ccccc13)CC2 |
| InChI | InChI=1S/C29H29FN2O3/c1-34-27-17-20-14-16-31(29(33)25(20)18-28(27)35-2)15-6-5-7-21-19-32(23-12-10-22(30)11-13-23)26-9-4-3-8-24(21)26/h3-4,8-13,17-19H,5-7,14-16H2,1-2H3 |
| InChIKey | HSLRDKQVBMJYOG-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 43.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 472.56 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[1-(4-fluorophenyl)indol-3-yl]butyl]-6,7-dimethoxy-3,4-dihydroisoquinolin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[1-(4-fluorophenyl)indol-3-yl]butyl]-6,7-dimethoxy-3,4-dihydroisoquinolin-1-one?
The IUPAC name of 2-[4-[1-(4-fluorophenyl)indol-3-yl]butyl]-6,7-dimethoxy-3,4-dihydroisoquinolin-1-one (CID 118720496) is 2-[4-[1-(4-fluorophenyl)indol-3-yl]butyl]-6,7-dimethoxy-3,4-dihydroisoquinolin-1-one.
What is the SMILES notation for 2-[4-[1-(4-fluorophenyl)indol-3-yl]butyl]-6,7-dimethoxy-3,4-dihydroisoquinolin-1-one?
The canonical SMILES for 2-[4-[1-(4-fluorophenyl)indol-3-yl]butyl]-6,7-dimethoxy-3,4-dihydroisoquinolin-1-one is COc1cc2c(cc1OC)C(=O)N(CCCCc1cn(-c3ccc(F)cc3)c3ccccc13)CC2.
What is the InChIKey of 2-[4-[1-(4-fluorophenyl)indol-3-yl]butyl]-6,7-dimethoxy-3,4-dihydroisoquinolin-1-one?
The InChIKey is HSLRDKQVBMJYOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H29FN2O3/c1-34-27-17-20-14-16-31(29(33)25(20)18-28(27)35-2)15-6-5-7-21-19-32(23-12-10-22(30)11-13-23)26-9-4-3-8-24(21)26/h3-4,8-13,17-19H,5-7,14-16H2,1-2H3.
What are the key properties of 2-[4-[1-(4-fluorophenyl)indol-3-yl]butyl]-6,7-dimethoxy-3,4-dihydroisoquinolin-1-one?
2-[4-[1-(4-fluorophenyl)indol-3-yl]butyl]-6,7-dimethoxy-3,4-dihydroisoquinolin-1-one has a molecular weight of 472.56 g/mol, XLogP of 5.81, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[1-(4-fluorophenyl)indol-3-yl]butyl]-6,7-dimethoxy-3,4-dihydroisoquinolin-1-one is sourced from PubChem (CID 118720496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).