C24H27F2N3O — CID 118720571
(2R,4R)-9-(2,4-difluorophenyl)-N-[(1R,2R,4S)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]-8,9-diazatricyclo[4.3.0.02,4]nona-1(6),7-diene-7-carboxamide (PubChem CID 118720571) has the molecular formula C24H27F2N3O and a molecular weight of 411.50 g/mol. Its IUPAC name is (2R,4R)-9-(2,4-difluorophenyl)-N-[(1R,2R,4S)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]-8,9-diazatricyclo[4.3.0.02,4]nona-1(6),7-diene-7-carboxamide.
| Compound Name | (2R,4R)-9-(2,4-difluorophenyl)-N-[(1R,2R,4S)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]-8,9-diazatricyclo[4.3.0.02,4]nona-1(6),7-diene-7-carboxamide |
|---|---|
| PubChem CID | 118720571 |
| Molecular Formula | C24H27F2N3O |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | (2R,4R)-9-(2,4-difluorophenyl)-N-[(1R,2R,4S)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]-8,9-diazatricyclo[4.3.0.02,4]nona-1(6),7-diene-7-carboxamide |
| SMILES | CC1(C)[C@H]2CC[C@](C)(C2)[C@H]1NC(=O)c1nn(-c2ccc(F)cc2F)c2c1C[C@H]1C[C@@H]21 |
| InChI | InChI=1S/C24H27F2N3O/c1-23(2)13-6-7-24(3,11-13)22(23)27-21(30)19-16-9-12-8-15(12)20(16)29(28-19)18-5-4-14(25)10-17(18)26/h4-5,10,12-13,15,22H,6-9,11H2,1-3H3,(H,27,30)/t12-,13+,15-,22+,24-/m1/s1 |
| InChIKey | OADZFRLWRRTMDX-HTERXRQYSA-N |
| XLogP | 4.75 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |