C36H58O7 — CID 118720685
[(1'R,2S,3'E,5'R,7'S,11'R,12'R,13'S,14'S)-11'-(2-ethylhexanoyloxy)-1'-hydroxy-3',6',6',14'-tetramethyl-2'-oxospiro[oxirane-2,10'-tricyclo[10.3.0.05,7]pentadec-3-ene]-13'-yl] 2-ethylhexanoate (PubChem CID 118720685) has the molecular formula C36H58O7 and a molecular weight of 602.85 g/mol. Its IUPAC name is [(1'R,2S,3'E,5'R,7'S,11'R,12'R,13'S,14'S)-11'-(2-ethylhexanoyloxy)-1'-hydroxy-3',6',6',14'-tetramethyl-2'-oxospiro[oxirane-2,10'-tricyclo[10.3.0.05,7]pentadec-3-ene]-13'-yl] 2-ethylhexanoate.
| Compound Name | [(1'R,2S,3'E,5'R,7'S,11'R,12'R,13'S,14'S)-11'-(2-ethylhexanoyloxy)-1'-hydroxy-3',6',6',14'-tetramethyl-2'-oxospiro[oxirane-2,10'-tricyclo[10.3.0.05,7]pentadec-3-ene]-13'-yl] 2-ethylhexanoate |
|---|---|
| PubChem CID | 118720685 |
| Molecular Formula | C36H58O7 |
| Molecular Weight | 602.85 g/mol |
| Exact Mass | 602.42 |
| IUPAC Name | [(1'R,2S,3'E,5'R,7'S,11'R,12'R,13'S,14'S)-11'-(2-ethylhexanoyloxy)-1'-hydroxy-3',6',6',14'-tetramethyl-2'-oxospiro[oxirane-2,10'-tricyclo[10.3.0.05,7]pentadec-3-ene]-13'-yl] 2-ethylhexanoate |
| SMILES | CCCCC(CC)C(=O)O[C@@H]1[C@@H]2[C@@H](OC(=O)C(CC)CCCC)[C@]3(CC[C@H]4[C@@H](/C=C(\C)C(=O)[C@@]2(O)C[C@@H]1C)C4(C)C)CO3 |
| InChI | InChI=1S/C36H58O7/c1-9-13-15-24(11-3)32(38)42-29-23(6)20-36(40)28(29)31(43-33(39)25(12-4)16-14-10-2)35(21-41-35)18-17-26-27(34(26,7)8)19-22(5)30(36)37/h19,23-29,31,40H,9-18,20-21H2,1-8H3/b22-19+/t23-,24?,25?,26-,27+,28+,29-,31+,35-,36+/m0/s1 |
| InChIKey | SAKSDRIXUAXTNG-SLPNQUJTSA-N |
| XLogP | 6.98 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.85 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|