About [(2Z)-3,7-dimethylocta-2,6-dienyl] 2-(4-chlorophenyl)acetate
[(2Z)-3,7-dimethylocta-2,6-dienyl] 2-(4-chlorophenyl)acetate (PubChem CID 118720720) has the molecular formula C18H23ClO2
and a molecular weight of 306.83 g/mol. Its IUPAC name is [(2Z)-3,7-dimethylocta-2,6-dienyl] 2-(4-chlorophenyl)acetate.
Molecular Properties
| Compound Name | [(2Z)-3,7-dimethylocta-2,6-dienyl] 2-(4-chlorophenyl)acetate |
| PubChem CID | 118720720 |
| Molecular Formula | C18H23ClO2 |
| Molecular Weight | 306.83 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | [(2Z)-3,7-dimethylocta-2,6-dienyl] 2-(4-chlorophenyl)acetate |
| SMILES | CC(C)=CCC/C(C)=C\COC(=O)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H23ClO2/c1-14(2)5-4-6-15(3)11-12-21-18(20)13-16-7-9-17(19)10-8-16/h5,7-11H,4,6,12-13H2,1-3H3/b15-11- |
| InChIKey | KVXLYQARERQHCG-PTNGSMBKSA-N |
| XLogP | 5.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 306.83 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(2Z)-3,7-dimethylocta-2,6-dienyl] 2-(4-chlorophenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2Z)-3,7-dimethylocta-2,6-dienyl] 2-(4-chlorophenyl)acetate?
The IUPAC name of [(2Z)-3,7-dimethylocta-2,6-dienyl] 2-(4-chlorophenyl)acetate (CID 118720720) is [(2Z)-3,7-dimethylocta-2,6-dienyl] 2-(4-chlorophenyl)acetate.
What is the SMILES notation for [(2Z)-3,7-dimethylocta-2,6-dienyl] 2-(4-chlorophenyl)acetate?
The canonical SMILES for [(2Z)-3,7-dimethylocta-2,6-dienyl] 2-(4-chlorophenyl)acetate is CC(C)=CCC/C(C)=C\COC(=O)Cc1ccc(Cl)cc1.
What is the InChIKey of [(2Z)-3,7-dimethylocta-2,6-dienyl] 2-(4-chlorophenyl)acetate?
The InChIKey is KVXLYQARERQHCG-PTNGSMBKSA-N. The full InChI is InChI=1S/C18H23ClO2/c1-14(2)5-4-6-15(3)11-12-21-18(20)13-16-7-9-17(19)10-8-16/h5,7-11H,4,6,12-13H2,1-3H3/b15-11-.
What are the key properties of [(2Z)-3,7-dimethylocta-2,6-dienyl] 2-(4-chlorophenyl)acetate?
[(2Z)-3,7-dimethylocta-2,6-dienyl] 2-(4-chlorophenyl)acetate has a molecular weight of 306.83 g/mol, XLogP of 5.12, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2Z)-3,7-dimethylocta-2,6-dienyl] 2-(4-chlorophenyl)acetate is sourced from PubChem (CID 118720720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).