About [(2Z)-3,7-dimethylocta-2,6-dienyl] 2-naphthalen-2-ylacetate
[(2Z)-3,7-dimethylocta-2,6-dienyl] 2-naphthalen-2-ylacetate (PubChem CID 118720723) has the molecular formula C22H26O2
and a molecular weight of 322.45 g/mol. Its IUPAC name is [(2Z)-3,7-dimethylocta-2,6-dienyl] 2-naphthalen-2-ylacetate.
Molecular Properties
| Compound Name | [(2Z)-3,7-dimethylocta-2,6-dienyl] 2-naphthalen-2-ylacetate |
| PubChem CID | 118720723 |
| Molecular Formula | C22H26O2 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | [(2Z)-3,7-dimethylocta-2,6-dienyl] 2-naphthalen-2-ylacetate |
| SMILES | CC(C)=CCC/C(C)=C\COC(=O)Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C22H26O2/c1-17(2)7-6-8-18(3)13-14-24-22(23)16-19-11-12-20-9-4-5-10-21(20)15-19/h4-5,7,9-13,15H,6,8,14,16H2,1-3H3/b18-13- |
| InChIKey | OBAINAGKLSFSNU-AQTBWJFISA-N |
| XLogP | 5.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(2Z)-3,7-dimethylocta-2,6-dienyl] 2-naphthalen-2-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2Z)-3,7-dimethylocta-2,6-dienyl] 2-naphthalen-2-ylacetate?
The IUPAC name of [(2Z)-3,7-dimethylocta-2,6-dienyl] 2-naphthalen-2-ylacetate (CID 118720723) is [(2Z)-3,7-dimethylocta-2,6-dienyl] 2-naphthalen-2-ylacetate.
What is the SMILES notation for [(2Z)-3,7-dimethylocta-2,6-dienyl] 2-naphthalen-2-ylacetate?
The canonical SMILES for [(2Z)-3,7-dimethylocta-2,6-dienyl] 2-naphthalen-2-ylacetate is CC(C)=CCC/C(C)=C\COC(=O)Cc1ccc2ccccc2c1.
What is the InChIKey of [(2Z)-3,7-dimethylocta-2,6-dienyl] 2-naphthalen-2-ylacetate?
The InChIKey is OBAINAGKLSFSNU-AQTBWJFISA-N. The full InChI is InChI=1S/C22H26O2/c1-17(2)7-6-8-18(3)13-14-24-22(23)16-19-11-12-20-9-4-5-10-21(20)15-19/h4-5,7,9-13,15H,6,8,14,16H2,1-3H3/b18-13-.
What are the key properties of [(2Z)-3,7-dimethylocta-2,6-dienyl] 2-naphthalen-2-ylacetate?
[(2Z)-3,7-dimethylocta-2,6-dienyl] 2-naphthalen-2-ylacetate has a molecular weight of 322.45 g/mol, XLogP of 5.62, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2Z)-3,7-dimethylocta-2,6-dienyl] 2-naphthalen-2-ylacetate is sourced from PubChem (CID 118720723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).