About 3,7-dimethyloct-6-enyl 3-phenylpropanoate
3,7-dimethyloct-6-enyl 3-phenylpropanoate (PubChem CID 118720733) has the molecular formula C19H28O2
and a molecular weight of 288.43 g/mol. Its IUPAC name is 3,7-dimethyloct-6-enyl 3-phenylpropanoate.
Molecular Properties
| Compound Name | 3,7-dimethyloct-6-enyl 3-phenylpropanoate |
| PubChem CID | 118720733 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | 3,7-dimethyloct-6-enyl 3-phenylpropanoate |
| SMILES | CC(C)=CCCC(C)CCOC(=O)CCc1ccccc1 |
| InChI | InChI=1S/C19H28O2/c1-16(2)8-7-9-17(3)14-15-21-19(20)13-12-18-10-5-4-6-11-18/h4-6,8,10-11,17H,7,9,12-15H2,1-3H3 |
| InChIKey | HBISZDDJJBUBOY-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3,7-dimethyloct-6-enyl 3-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-dimethyloct-6-enyl 3-phenylpropanoate?
The IUPAC name of 3,7-dimethyloct-6-enyl 3-phenylpropanoate (CID 118720733) is 3,7-dimethyloct-6-enyl 3-phenylpropanoate.
What is the SMILES notation for 3,7-dimethyloct-6-enyl 3-phenylpropanoate?
The canonical SMILES for 3,7-dimethyloct-6-enyl 3-phenylpropanoate is CC(C)=CCCC(C)CCOC(=O)CCc1ccccc1.
What is the InChIKey of 3,7-dimethyloct-6-enyl 3-phenylpropanoate?
The InChIKey is HBISZDDJJBUBOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28O2/c1-16(2)8-7-9-17(3)14-15-21-19(20)13-12-18-10-5-4-6-11-18/h4-6,8,10-11,17H,7,9,12-15H2,1-3H3.
What are the key properties of 3,7-dimethyloct-6-enyl 3-phenylpropanoate?
3,7-dimethyloct-6-enyl 3-phenylpropanoate has a molecular weight of 288.43 g/mol, XLogP of 4.93, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-dimethyloct-6-enyl 3-phenylpropanoate is sourced from PubChem (CID 118720733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).