C20H26O4 — CID 118720768
(4bS,8aR,9S)-4,7,9-trihydroxy-4b,8,8-trimethyl-2-propan-2-yl-8a,9-dihydro-7H-phenanthren-3-one (PubChem CID 118720768) has the molecular formula C20H26O4 and a molecular weight of 330.42 g/mol. Its IUPAC name is (4bS,8aR,9S)-4,7,9-trihydroxy-4b,8,8-trimethyl-2-propan-2-yl-8a,9-dihydro-7H-phenanthren-3-one.
| Compound Name | (4bS,8aR,9S)-4,7,9-trihydroxy-4b,8,8-trimethyl-2-propan-2-yl-8a,9-dihydro-7H-phenanthren-3-one |
|---|---|
| PubChem CID | 118720768 |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | (4bS,8aR,9S)-4,7,9-trihydroxy-4b,8,8-trimethyl-2-propan-2-yl-8a,9-dihydro-7H-phenanthren-3-one |
| SMILES | CC(C)C1=CC2=C[C@H](O)[C@H]3C(C)(C)C(O)C=C[C@]3(C)C2=C(O)C1=O |
| InChI | InChI=1S/C20H26O4/c1-10(2)12-8-11-9-13(21)18-19(3,4)14(22)6-7-20(18,5)15(11)17(24)16(12)23/h6-10,13-14,18,21-22,24H,1-5H3/t13-,14?,18-,20+/m0/s1 |
| InChIKey | UWKGGXLIJUTVGY-QJYUMCHISA-N |
| XLogP | 2.84 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|