About N-[(3,4-dimethoxyphenyl)methyl]-N-ethyl-4-[1-(4-fluorophenyl)indol-3-yl]butan-1-amine
N-[(3,4-dimethoxyphenyl)methyl]-N-ethyl-4-[1-(4-fluorophenyl)indol-3-yl]butan-1-amine (PubChem CID 118720780) has the molecular formula C29H33FN2O2
and a molecular weight of 460.59 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-N-ethyl-4-[1-(4-fluorophenyl)indol-3-yl]butan-1-amine.
Molecular Properties
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-N-ethyl-4-[1-(4-fluorophenyl)indol-3-yl]butan-1-amine |
| PubChem CID | 118720780 |
| Molecular Formula | C29H33FN2O2 |
| Molecular Weight | 460.59 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-N-ethyl-4-[1-(4-fluorophenyl)indol-3-yl]butan-1-amine |
| SMILES | CCN(CCCCc1cn(-c2ccc(F)cc2)c2ccccc12)Cc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C29H33FN2O2/c1-4-31(20-22-12-17-28(33-2)29(19-22)34-3)18-8-7-9-23-21-32(25-15-13-24(30)14-16-25)27-11-6-5-10-26(23)27/h5-6,10-17,19,21H,4,7-9,18,20H2,1-3H3 |
| InChIKey | QRKWVWPQUBNIGQ-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 26.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 460.59 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[(3,4-dimethoxyphenyl)methyl]-N-ethyl-4-[1-(4-fluorophenyl)indol-3-yl]butan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,4-dimethoxyphenyl)methyl]-N-ethyl-4-[1-(4-fluorophenyl)indol-3-yl]butan-1-amine?
The IUPAC name of N-[(3,4-dimethoxyphenyl)methyl]-N-ethyl-4-[1-(4-fluorophenyl)indol-3-yl]butan-1-amine (CID 118720780) is N-[(3,4-dimethoxyphenyl)methyl]-N-ethyl-4-[1-(4-fluorophenyl)indol-3-yl]butan-1-amine.
What is the SMILES notation for N-[(3,4-dimethoxyphenyl)methyl]-N-ethyl-4-[1-(4-fluorophenyl)indol-3-yl]butan-1-amine?
The canonical SMILES for N-[(3,4-dimethoxyphenyl)methyl]-N-ethyl-4-[1-(4-fluorophenyl)indol-3-yl]butan-1-amine is CCN(CCCCc1cn(-c2ccc(F)cc2)c2ccccc12)Cc1ccc(OC)c(OC)c1.
What is the InChIKey of N-[(3,4-dimethoxyphenyl)methyl]-N-ethyl-4-[1-(4-fluorophenyl)indol-3-yl]butan-1-amine?
The InChIKey is QRKWVWPQUBNIGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H33FN2O2/c1-4-31(20-22-12-17-28(33-2)29(19-22)34-3)18-8-7-9-23-21-32(25-15-13-24(30)14-16-25)27-11-6-5-10-26(23)27/h5-6,10-17,19,21H,4,7-9,18,20H2,1-3H3.
What are the key properties of N-[(3,4-dimethoxyphenyl)methyl]-N-ethyl-4-[1-(4-fluorophenyl)indol-3-yl]butan-1-amine?
N-[(3,4-dimethoxyphenyl)methyl]-N-ethyl-4-[1-(4-fluorophenyl)indol-3-yl]butan-1-amine has a molecular weight of 460.59 g/mol, XLogP of 6.63, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,4-dimethoxyphenyl)methyl]-N-ethyl-4-[1-(4-fluorophenyl)indol-3-yl]butan-1-amine is sourced from PubChem (CID 118720780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).