C32H36O7 — CID 118720799
(2S,4S,5S)-4-(2,6-dimethoxyphenyl)-5-[(E)-3-(2,6-dimethoxyphenyl)prop-2-enyl]-2-[(E)-2-(2-methoxyphenyl)ethenyl]-1,3-dioxane (PubChem CID 118720799) has the molecular formula C32H36O7 and a molecular weight of 532.63 g/mol. Its IUPAC name is (2S,4S,5S)-4-(2,6-dimethoxyphenyl)-5-[(E)-3-(2,6-dimethoxyphenyl)prop-2-enyl]-2-[(E)-2-(2-methoxyphenyl)ethenyl]-1,3-dioxane.
| Compound Name | (2S,4S,5S)-4-(2,6-dimethoxyphenyl)-5-[(E)-3-(2,6-dimethoxyphenyl)prop-2-enyl]-2-[(E)-2-(2-methoxyphenyl)ethenyl]-1,3-dioxane |
|---|---|
| PubChem CID | 118720799 |
| Molecular Formula | C32H36O7 |
| Molecular Weight | 532.63 g/mol |
| Exact Mass | 532.25 |
| IUPAC Name | (2S,4S,5S)-4-(2,6-dimethoxyphenyl)-5-[(E)-3-(2,6-dimethoxyphenyl)prop-2-enyl]-2-[(E)-2-(2-methoxyphenyl)ethenyl]-1,3-dioxane |
| SMILES | COc1ccccc1/C=C/[C@H]1OC[C@H](C/C=C/c2c(OC)cccc2OC)[C@@H](c2c(OC)cccc2OC)O1 |
| InChI | InChI=1S/C32H36O7/c1-33-25-14-7-6-11-22(25)19-20-30-38-21-23(12-8-13-24-26(34-2)15-9-16-27(24)35-3)32(39-30)31-28(36-4)17-10-18-29(31)37-5/h6-11,13-20,23,30,32H,12,21H2,1-5H3/b13-8+,20-19+/t23-,30-,32-/m0/s1 |
| InChIKey | LSTQHYSVLGDHPP-JOGLSMEVSA-N |
| XLogP | 6.58 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.63 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |