C20H32O2 — CID 118720808
(1R,3aR,5E,9Z,12aR)-1-hydroxy-3a,6,10-trimethyl-1-propan-2-yl-3,4,7,8,12,12a-hexahydro-2H-cyclopenta[11]annulen-11-one (PubChem CID 118720808) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is (1R,3aR,5E,9Z,12aR)-1-hydroxy-3a,6,10-trimethyl-1-propan-2-yl-3,4,7,8,12,12a-hexahydro-2H-cyclopenta[11]annulen-11-one.
| Compound Name | (1R,3aR,5E,9Z,12aR)-1-hydroxy-3a,6,10-trimethyl-1-propan-2-yl-3,4,7,8,12,12a-hexahydro-2H-cyclopenta[11]annulen-11-one |
|---|---|
| PubChem CID | 118720808 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | (1R,3aR,5E,9Z,12aR)-1-hydroxy-3a,6,10-trimethyl-1-propan-2-yl-3,4,7,8,12,12a-hexahydro-2H-cyclopenta[11]annulen-11-one |
| SMILES | C/C1=C/CC/C(C)=C/C[C@@]2(C)CC[C@@](O)(C(C)C)[C@@H]2CC1=O |
| InChI | InChI=1S/C20H32O2/c1-14(2)20(22)12-11-19(5)10-9-15(3)7-6-8-16(4)17(21)13-18(19)20/h8-9,14,18,22H,6-7,10-13H2,1-5H3/b15-9+,16-8-/t18-,19+,20-/m1/s1 |
| InChIKey | MCJSLFXSJDGDHD-NGGWOXFDSA-N |
| XLogP | 4.83 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|