C20H32O3 — CID 118720809
(3aS,4S,5R,6S,8aR)-5-[(2S)-2-hydroxy-6-methylhept-5-en-2-yl]-3-methyl-8-methylidene-3a,4,5,6,7,8a-hexahydro-1H-azulene-4,6-diol (PubChem CID 118720809) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is (3aS,4S,5R,6S,8aR)-5-[(2S)-2-hydroxy-6-methylhept-5-en-2-yl]-3-methyl-8-methylidene-3a,4,5,6,7,8a-hexahydro-1H-azulene-4,6-diol.
| Compound Name | (3aS,4S,5R,6S,8aR)-5-[(2S)-2-hydroxy-6-methylhept-5-en-2-yl]-3-methyl-8-methylidene-3a,4,5,6,7,8a-hexahydro-1H-azulene-4,6-diol |
|---|---|
| PubChem CID | 118720809 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | (3aS,4S,5R,6S,8aR)-5-[(2S)-2-hydroxy-6-methylhept-5-en-2-yl]-3-methyl-8-methylidene-3a,4,5,6,7,8a-hexahydro-1H-azulene-4,6-diol |
| SMILES | C=C1C[C@H](O)[C@@H]([C@@](C)(O)CCC=C(C)C)[C@@H](O)[C@@H]2C(C)=CC[C@@H]12 |
| InChI | InChI=1S/C20H32O3/c1-12(2)7-6-10-20(5,23)18-16(21)11-14(4)15-9-8-13(3)17(15)19(18)22/h7-8,15-19,21-23H,4,6,9-11H2,1-3,5H3/t15-,16-,17+,18+,19-,20-/m0/s1 |
| InChIKey | MVFPHQGMZUMNFE-GTYQWKCWSA-N |
| XLogP | 3.36 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|