C26H30Cl2FN3O4 — CID 118720815
(2'R,3R,3'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-N-[(3S)-3,4-dihydroxybutyl]-5',5'-diethyl-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide (PubChem CID 118720815) has the molecular formula C26H30Cl2FN3O4 and a molecular weight of 538.45 g/mol. Its IUPAC name is (2'R,3R,3'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-N-[(3S)-3,4-dihydroxybutyl]-5',5'-diethyl-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide.
| Compound Name | (2'R,3R,3'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-N-[(3S)-3,4-dihydroxybutyl]-5',5'-diethyl-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide |
|---|---|
| PubChem CID | 118720815 |
| Molecular Formula | C26H30Cl2FN3O4 |
| Molecular Weight | 538.45 g/mol |
| Exact Mass | 537.16 |
| IUPAC Name | (2'R,3R,3'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-N-[(3S)-3,4-dihydroxybutyl]-5',5'-diethyl-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide |
| SMILES | CCC1(CC)N[C@@H](C(=O)NCC[C@H](O)CO)[C@H](c2cccc(Cl)c2F)[C@]12C(=O)Nc1cc(Cl)ccc12 |
| InChI | InChI=1S/C26H30Cl2FN3O4/c1-3-25(4-2)26(17-9-8-14(27)12-19(17)31-24(26)36)20(16-6-5-7-18(28)21(16)29)22(32-25)23(35)30-11-10-15(34)13-33/h5-9,12,15,20,22,32-34H,3-4,10-11,13H2,1-2H3,(H,30,35)(H,31,36)/t15-,20-,22+,26+/m0/s1 |
| InChIKey | NNZUFCOOBFLHAN-RTWSZVFMSA-N |
| XLogP | 3.50 |
| TPSA | 110.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.45 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |