C12H8ClF3O3 — CID 118720947
(2S)-6-chloro-8-(trideuteriomethyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid (PubChem CID 118720947) has the molecular formula C12H8ClF3O3 and a molecular weight of 295.66 g/mol. Its IUPAC name is (2S)-6-chloro-8-(trideuteriomethyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid.
| Compound Name | (2S)-6-chloro-8-(trideuteriomethyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 118720947 |
| Molecular Formula | C12H8ClF3O3 |
| Molecular Weight | 295.66 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | (2S)-6-chloro-8-(trideuteriomethyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
| SMILES | [2H]C([2H])([2H])c1cc(Cl)cc2c1O[C@H](C(F)(F)F)C(C(=O)O)=C2 |
| InChI | InChI=1S/C12H8ClF3O3/c1-5-2-7(13)3-6-4-8(11(17)18)10(12(14,15)16)19-9(5)6/h2-4,10H,1H3,(H,17,18)/t10-/m0/s1/i1D3 |
| InChIKey | NONBXOPYDWLZGR-ASGODXDTSA-N |
| XLogP | 3.44 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.66 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |