About 6-(3-cyclopropylsulfonylphenyl)-3-(4-methylsulfonylphenyl)imidazo[1,2-b]pyridazine
6-(3-cyclopropylsulfonylphenyl)-3-(4-methylsulfonylphenyl)imidazo[1,2-b]pyridazine (PubChem CID 118720972) has the molecular formula C22H19N3O4S2
and a molecular weight of 453.55 g/mol. Its IUPAC name is 6-(3-cyclopropylsulfonylphenyl)-3-(4-methylsulfonylphenyl)imidazo[1,2-b]pyridazine.
Molecular Properties
| Compound Name | 6-(3-cyclopropylsulfonylphenyl)-3-(4-methylsulfonylphenyl)imidazo[1,2-b]pyridazine |
| PubChem CID | 118720972 |
| Molecular Formula | C22H19N3O4S2 |
| Molecular Weight | 453.55 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | 6-(3-cyclopropylsulfonylphenyl)-3-(4-methylsulfonylphenyl)imidazo[1,2-b]pyridazine |
| SMILES | CS(=O)(=O)c1ccc(-c2cnc3ccc(-c4cccc(S(=O)(=O)C5CC5)c4)nn23)cc1 |
| InChI | InChI=1S/C22H19N3O4S2/c1-30(26,27)17-7-5-15(6-8-17)21-14-23-22-12-11-20(24-25(21)22)16-3-2-4-19(13-16)31(28,29)18-9-10-18/h2-8,11-14,18H,9-10H2,1H3 |
| InChIKey | CMWOZPDEAWRWER-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 98.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 453.55 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6-(3-cyclopropylsulfonylphenyl)-3-(4-methylsulfonylphenyl)imidazo[1,2-b]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-cyclopropylsulfonylphenyl)-3-(4-methylsulfonylphenyl)imidazo[1,2-b]pyridazine?
The IUPAC name of 6-(3-cyclopropylsulfonylphenyl)-3-(4-methylsulfonylphenyl)imidazo[1,2-b]pyridazine (CID 118720972) is 6-(3-cyclopropylsulfonylphenyl)-3-(4-methylsulfonylphenyl)imidazo[1,2-b]pyridazine.
What is the SMILES notation for 6-(3-cyclopropylsulfonylphenyl)-3-(4-methylsulfonylphenyl)imidazo[1,2-b]pyridazine?
The canonical SMILES for 6-(3-cyclopropylsulfonylphenyl)-3-(4-methylsulfonylphenyl)imidazo[1,2-b]pyridazine is CS(=O)(=O)c1ccc(-c2cnc3ccc(-c4cccc(S(=O)(=O)C5CC5)c4)nn23)cc1.
What is the InChIKey of 6-(3-cyclopropylsulfonylphenyl)-3-(4-methylsulfonylphenyl)imidazo[1,2-b]pyridazine?
The InChIKey is CMWOZPDEAWRWER-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19N3O4S2/c1-30(26,27)17-7-5-15(6-8-17)21-14-23-22-12-11-20(24-25(21)22)16-3-2-4-19(13-16)31(28,29)18-9-10-18/h2-8,11-14,18H,9-10H2,1H3.
What are the key properties of 6-(3-cyclopropylsulfonylphenyl)-3-(4-methylsulfonylphenyl)imidazo[1,2-b]pyridazine?
6-(3-cyclopropylsulfonylphenyl)-3-(4-methylsulfonylphenyl)imidazo[1,2-b]pyridazine has a molecular weight of 453.55 g/mol, XLogP of 3.40, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-cyclopropylsulfonylphenyl)-3-(4-methylsulfonylphenyl)imidazo[1,2-b]pyridazine is sourced from PubChem (CID 118720972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).