C21H25NO3 — CID 118721166
(2Z,4E)-5-(1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl)-3-methyl-N-phenylpenta-2,4-dienamide (PubChem CID 118721166) has the molecular formula C21H25NO3 and a molecular weight of 339.44 g/mol. Its IUPAC name is (2Z,4E)-5-(1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl)-3-methyl-N-phenylpenta-2,4-dienamide.
| Compound Name | (2Z,4E)-5-(1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl)-3-methyl-N-phenylpenta-2,4-dienamide |
|---|---|
| PubChem CID | 118721166 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | (2Z,4E)-5-(1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl)-3-methyl-N-phenylpenta-2,4-dienamide |
| SMILES | CC1=CC(=O)CC(C)(C)C1(O)/C=C/C(C)=C\C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C21H25NO3/c1-15(12-19(24)22-17-8-6-5-7-9-17)10-11-21(25)16(2)13-18(23)14-20(21,3)4/h5-13,25H,14H2,1-4H3,(H,22,24)/b11-10+,15-12- |
| InChIKey | FCCILWXQYXSXQJ-JWIYKGGMSA-N |
| XLogP | 3.80 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|