About (5Z)-5-[(1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl)methylidene]-4-methylfuran-2-one
(5Z)-5-[(1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl)methylidene]-4-methylfuran-2-one (PubChem CID 118721169) has the molecular formula C15H18O4
and a molecular weight of 262.31 g/mol. Its IUPAC name is (5Z)-5-[(1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl)methylidene]-4-methylfuran-2-one.
Molecular Properties
| Compound Name | (5Z)-5-[(1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl)methylidene]-4-methylfuran-2-one |
| PubChem CID | 118721169 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | (5Z)-5-[(1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl)methylidene]-4-methylfuran-2-one |
| SMILES | CC1=CC(=O)O/C1=C\C1(O)C(C)=CC(=O)CC1(C)C |
| InChI | InChI=1S/C15H18O4/c1-9-5-13(17)19-12(9)8-15(18)10(2)6-11(16)7-14(15,3)4/h5-6,8,18H,7H2,1-4H3/b12-8- |
| InChIKey | SOTHFYJFEYFTOL-WQLSENKSSA-N |
| XLogP | 2.05 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5Z)-5-[(1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl)methylidene]-4-methylfuran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z)-5-[(1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl)methylidene]-4-methylfuran-2-one?
The IUPAC name of (5Z)-5-[(1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl)methylidene]-4-methylfuran-2-one (CID 118721169) is (5Z)-5-[(1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl)methylidene]-4-methylfuran-2-one.
What is the SMILES notation for (5Z)-5-[(1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl)methylidene]-4-methylfuran-2-one?
The canonical SMILES for (5Z)-5-[(1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl)methylidene]-4-methylfuran-2-one is CC1=CC(=O)O/C1=C\C1(O)C(C)=CC(=O)CC1(C)C.
What is the InChIKey of (5Z)-5-[(1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl)methylidene]-4-methylfuran-2-one?
The InChIKey is SOTHFYJFEYFTOL-WQLSENKSSA-N. The full InChI is InChI=1S/C15H18O4/c1-9-5-13(17)19-12(9)8-15(18)10(2)6-11(16)7-14(15,3)4/h5-6,8,18H,7H2,1-4H3/b12-8-.
What are the key properties of (5Z)-5-[(1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl)methylidene]-4-methylfuran-2-one?
(5Z)-5-[(1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl)methylidene]-4-methylfuran-2-one has a molecular weight of 262.31 g/mol, XLogP of 2.05, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z)-5-[(1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl)methylidene]-4-methylfuran-2-one is sourced from PubChem (CID 118721169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).