C21H32O6 — CID 118721177
[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] (2Z,4E)-5-(1,4-dihydroxy-2,6,6-trimethylcyclohex-2-en-1-yl)-3-methylpenta-2,4-dienoate (PubChem CID 118721177) has the molecular formula C21H32O6 and a molecular weight of 380.48 g/mol. Its IUPAC name is [2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] (2Z,4E)-5-(1,4-dihydroxy-2,6,6-trimethylcyclohex-2-en-1-yl)-3-methylpenta-2,4-dienoate.
| Compound Name | [2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] (2Z,4E)-5-(1,4-dihydroxy-2,6,6-trimethylcyclohex-2-en-1-yl)-3-methylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 118721177 |
| Molecular Formula | C21H32O6 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | [2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] (2Z,4E)-5-(1,4-dihydroxy-2,6,6-trimethylcyclohex-2-en-1-yl)-3-methylpenta-2,4-dienoate |
| SMILES | CC1=CC(O)CC(C)(C)C1(O)/C=C/C(C)=C\C(=O)OCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H32O6/c1-14(10-17(23)26-13-18(24)27-19(3,4)5)8-9-21(25)15(2)11-16(22)12-20(21,6)7/h8-11,16,22,25H,12-13H2,1-7H3/b9-8+,14-10- |
| InChIKey | KATYGPKDIWWZCL-RBDUQRJVSA-N |
| XLogP | 2.84 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|