About 4-piperazin-1-yl-2,5-dithiophen-2-ylthieno[2,3-d]pyrimidine;hydrochloride
4-piperazin-1-yl-2,5-dithiophen-2-ylthieno[2,3-d]pyrimidine;hydrochloride (PubChem CID 118721288) has the molecular formula C18H17ClN4S3
and a molecular weight of 421.02 g/mol. Its IUPAC name is 4-piperazin-1-yl-2,5-dithiophen-2-ylthieno[2,3-d]pyrimidine;hydrochloride.
Molecular Properties
| Compound Name | 4-piperazin-1-yl-2,5-dithiophen-2-ylthieno[2,3-d]pyrimidine;hydrochloride |
| PubChem CID | 118721288 |
| Molecular Formula | C18H17ClN4S3 |
| Molecular Weight | 421.02 g/mol |
| Exact Mass | 420.03 |
| IUPAC Name | 4-piperazin-1-yl-2,5-dithiophen-2-ylthieno[2,3-d]pyrimidine;hydrochloride |
| SMILES | Cl.c1csc(-c2nc(N3CCNCC3)c3c(-c4cccs4)csc3n2)c1 |
| InChI | InChI=1S/C18H16N4S3.ClH/c1-3-13(23-9-1)12-11-25-18-15(12)17(22-7-5-19-6-8-22)20-16(21-18)14-4-2-10-24-14;/h1-4,9-11,19H,5-8H2;1H |
| InChIKey | HFJLFYNATMPMFX-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.02 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-piperazin-1-yl-2,5-dithiophen-2-ylthieno[2,3-d]pyrimidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-piperazin-1-yl-2,5-dithiophen-2-ylthieno[2,3-d]pyrimidine;hydrochloride?
The IUPAC name of 4-piperazin-1-yl-2,5-dithiophen-2-ylthieno[2,3-d]pyrimidine;hydrochloride (CID 118721288) is 4-piperazin-1-yl-2,5-dithiophen-2-ylthieno[2,3-d]pyrimidine;hydrochloride.
What is the SMILES notation for 4-piperazin-1-yl-2,5-dithiophen-2-ylthieno[2,3-d]pyrimidine;hydrochloride?
The canonical SMILES for 4-piperazin-1-yl-2,5-dithiophen-2-ylthieno[2,3-d]pyrimidine;hydrochloride is Cl.c1csc(-c2nc(N3CCNCC3)c3c(-c4cccs4)csc3n2)c1.
What is the InChIKey of 4-piperazin-1-yl-2,5-dithiophen-2-ylthieno[2,3-d]pyrimidine;hydrochloride?
The InChIKey is HFJLFYNATMPMFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N4S3.ClH/c1-3-13(23-9-1)12-11-25-18-15(12)17(22-7-5-19-6-8-22)20-16(21-18)14-4-2-10-24-14;/h1-4,9-11,19H,5-8H2;1H.
What are the key properties of 4-piperazin-1-yl-2,5-dithiophen-2-ylthieno[2,3-d]pyrimidine;hydrochloride?
4-piperazin-1-yl-2,5-dithiophen-2-ylthieno[2,3-d]pyrimidine;hydrochloride has a molecular weight of 421.02 g/mol, XLogP of 4.98, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-piperazin-1-yl-2,5-dithiophen-2-ylthieno[2,3-d]pyrimidine;hydrochloride is sourced from PubChem (CID 118721288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).