C18H24F3N3O3 — CID 118721309
2-[(1R,2S)-2-[5-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-3-pyridinyl]cyclopropyl]ethanol;2,2,2-trifluoroacetic acid (PubChem CID 118721309) has the molecular formula C18H24F3N3O3 and a molecular weight of 387.40 g/mol. Its IUPAC name is 2-[(1R,2S)-2-[5-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-3-pyridinyl]cyclopropyl]ethanol;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[(1R,2S)-2-[5-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-3-pyridinyl]cyclopropyl]ethanol;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118721309 |
| Molecular Formula | C18H24F3N3O3 |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 2-[(1R,2S)-2-[5-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-3-pyridinyl]cyclopropyl]ethanol;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.OCC[C@H]1C[C@@H]1c1cncc(N2C[C@H]3CNC[C@H]3C2)c1 |
| InChI | InChI=1S/C16H23N3O.C2HF3O2/c20-2-1-11-4-16(11)12-3-15(8-18-5-12)19-9-13-6-17-7-14(13)10-19;3-2(4,5)1(6)7/h3,5,8,11,13-14,16-17,20H,1-2,4,6-7,9-10H2;(H,6,7)/t11-,13-,14+,16-;/m0./s1 |
| InChIKey | ZHCHJKGZEZDUKA-FUUIRLHUSA-N |
| XLogP | 1.86 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |