C16H23N3O — CID 118721310
2-[(1R,2S)-2-[5-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-3-pyridinyl]cyclopropyl]ethanol (PubChem CID 118721310) has the molecular formula C16H23N3O and a molecular weight of 273.38 g/mol. Its IUPAC name is 2-[(1R,2S)-2-[5-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-3-pyridinyl]cyclopropyl]ethanol.
| Compound Name | 2-[(1R,2S)-2-[5-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-3-pyridinyl]cyclopropyl]ethanol |
|---|---|
| PubChem CID | 118721310 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | 2-[(1R,2S)-2-[5-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-3-pyridinyl]cyclopropyl]ethanol |
| SMILES | OCC[C@H]1C[C@@H]1c1cncc(N2C[C@H]3CNC[C@H]3C2)c1 |
| InChI | InChI=1S/C16H23N3O/c20-2-1-11-4-16(11)12-3-15(8-18-5-12)19-9-13-6-17-7-14(13)10-19/h3,5,8,11,13-14,16-17,20H,1-2,4,6-7,9-10H2/t11-,13-,14+,16-/m0/s1 |
| InChIKey | PEAGCBDUMAQJJR-ZIEJDFEHSA-N |
| XLogP | 1.22 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |