C18H23F4N3O2 — CID 118721311
(3aS,6aR)-5-[5-[(1S,2R)-2-(2-fluoroethyl)cyclopropyl]-3-pyridinyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;2,2,2-trifluoroacetic acid (PubChem CID 118721311) has the molecular formula C18H23F4N3O2 and a molecular weight of 389.39 g/mol. Its IUPAC name is (3aS,6aR)-5-[5-[(1S,2R)-2-(2-fluoroethyl)cyclopropyl]-3-pyridinyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;2,2,2-trifluoroacetic acid.
| Compound Name | (3aS,6aR)-5-[5-[(1S,2R)-2-(2-fluoroethyl)cyclopropyl]-3-pyridinyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118721311 |
| Molecular Formula | C18H23F4N3O2 |
| Molecular Weight | 389.39 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | (3aS,6aR)-5-[5-[(1S,2R)-2-(2-fluoroethyl)cyclopropyl]-3-pyridinyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;2,2,2-trifluoroacetic acid |
| SMILES | FCC[C@H]1C[C@@H]1c1cncc(N2C[C@H]3CNC[C@H]3C2)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H22FN3.C2HF3O2/c17-2-1-11-4-16(11)12-3-15(8-19-5-12)20-9-13-6-18-7-14(13)10-20;3-2(4,5)1(6)7/h3,5,8,11,13-14,16,18H,1-2,4,6-7,9-10H2;(H,6,7)/t11-,13-,14+,16-;/m0./s1 |
| InChIKey | RKEIEMMDGAEBGE-FUUIRLHUSA-N |
| XLogP | 2.83 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.39 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |