C20H28F3N3O3 — CID 118721313
(3aR,6aS)-5-[5-[(1S,2R)-2-(2-ethoxyethyl)cyclopropyl]-3-pyridinyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;2,2,2-trifluoroacetic acid (PubChem CID 118721313) has the molecular formula C20H28F3N3O3 and a molecular weight of 415.46 g/mol. Its IUPAC name is (3aR,6aS)-5-[5-[(1S,2R)-2-(2-ethoxyethyl)cyclopropyl]-3-pyridinyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;2,2,2-trifluoroacetic acid.
| Compound Name | (3aR,6aS)-5-[5-[(1S,2R)-2-(2-ethoxyethyl)cyclopropyl]-3-pyridinyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118721313 |
| Molecular Formula | C20H28F3N3O3 |
| Molecular Weight | 415.46 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | (3aR,6aS)-5-[5-[(1S,2R)-2-(2-ethoxyethyl)cyclopropyl]-3-pyridinyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;2,2,2-trifluoroacetic acid |
| SMILES | CCOCC[C@H]1C[C@@H]1c1cncc(N2C[C@H]3CNC[C@H]3C2)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H27N3O.C2HF3O2/c1-2-22-4-3-13-6-18(13)14-5-17(10-20-7-14)21-11-15-8-19-9-16(15)12-21;3-2(4,5)1(6)7/h5,7,10,13,15-16,18-19H,2-4,6,8-9,11-12H2,1H3;(H,6,7)/t13-,15-,16+,18-;/m0./s1 |
| InChIKey | JNLSCODRHBNQPH-QHIYURPZSA-N |
| XLogP | 2.90 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.46 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|