C23H26F3N3O4 — CID 118721335
3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]-3-[3-(trifluoromethoxy)phenyl]propanoic acid (PubChem CID 118721335) has the molecular formula C23H26F3N3O4 and a molecular weight of 465.47 g/mol. Its IUPAC name is 3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]-3-[3-(trifluoromethoxy)phenyl]propanoic acid.
| Compound Name | 3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]-3-[3-(trifluoromethoxy)phenyl]propanoic acid |
|---|---|
| PubChem CID | 118721335 |
| Molecular Formula | C23H26F3N3O4 |
| Molecular Weight | 465.47 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | 3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]-3-[3-(trifluoromethoxy)phenyl]propanoic acid |
| SMILES | O=C(O)CC(NC(=O)CCCCc1ccc2c(n1)NCCC2)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C23H26F3N3O4/c24-23(25,26)33-18-8-3-5-16(13-18)19(14-21(31)32)29-20(30)9-2-1-7-17-11-10-15-6-4-12-27-22(15)28-17/h3,5,8,10-11,13,19H,1-2,4,6-7,9,12,14H2,(H,27,28)(H,29,30)(H,31,32) |
| InChIKey | SBBQXRAHGMRHHD-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.47 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|