C22H25Cl2N3O3 — CID 118721337
3-(3,4-dichlorophenyl)-3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]propanoic acid (PubChem CID 118721337) has the molecular formula C22H25Cl2N3O3 and a molecular weight of 450.37 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]propanoic acid.
| Compound Name | 3-(3,4-dichlorophenyl)-3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]propanoic acid |
|---|---|
| PubChem CID | 118721337 |
| Molecular Formula | C22H25Cl2N3O3 |
| Molecular Weight | 450.37 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]propanoic acid |
| SMILES | O=C(O)CC(NC(=O)CCCCc1ccc2c(n1)NCCC2)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H25Cl2N3O3/c23-17-10-8-15(12-18(17)24)19(13-21(29)30)27-20(28)6-2-1-5-16-9-7-14-4-3-11-25-22(14)26-16/h7-10,12,19H,1-6,11,13H2,(H,25,26)(H,27,28)(H,29,30) |
| InChIKey | CLKNROZINQMWHM-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.37 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|