C23H25ClF3N3O3 — CID 118721343
3-[4-chloro-3-(trifluoromethyl)phenyl]-3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]propanoic acid (PubChem CID 118721343) has the molecular formula C23H25ClF3N3O3 and a molecular weight of 483.92 g/mol. Its IUPAC name is 3-[4-chloro-3-(trifluoromethyl)phenyl]-3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]propanoic acid.
| Compound Name | 3-[4-chloro-3-(trifluoromethyl)phenyl]-3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]propanoic acid |
|---|---|
| PubChem CID | 118721343 |
| Molecular Formula | C23H25ClF3N3O3 |
| Molecular Weight | 483.92 g/mol |
| Exact Mass | 483.15 |
| IUPAC Name | 3-[4-chloro-3-(trifluoromethyl)phenyl]-3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]propanoic acid |
| SMILES | O=C(O)CC(NC(=O)CCCCc1ccc2c(n1)NCCC2)c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H25ClF3N3O3/c24-18-10-8-15(12-17(18)23(25,26)27)19(13-21(32)33)30-20(31)6-2-1-5-16-9-7-14-4-3-11-28-22(14)29-16/h7-10,12,19H,1-6,11,13H2,(H,28,29)(H,30,31)(H,32,33) |
| InChIKey | WKUJBINSWXARAG-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.92 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|