C39H42Cl3F2N5 — CID 118721508
N,5-bis(3-chloro-4-fluorophenyl)-3-[6-(1,2,3,4,6,7,8,9-octahydroquinolizin-9a-yl)hexylimino]phenazin-2-amine;hydrochloride (PubChem CID 118721508) has the molecular formula C39H42Cl3F2N5 and a molecular weight of 725.16 g/mol. Its IUPAC name is N,5-bis(3-chloro-4-fluorophenyl)-3-[6-(1,2,3,4,6,7,8,9-octahydroquinolizin-9a-yl)hexylimino]phenazin-2-amine;hydrochloride.
| Compound Name | N,5-bis(3-chloro-4-fluorophenyl)-3-[6-(1,2,3,4,6,7,8,9-octahydroquinolizin-9a-yl)hexylimino]phenazin-2-amine;hydrochloride |
|---|---|
| PubChem CID | 118721508 |
| Molecular Formula | C39H42Cl3F2N5 |
| Molecular Weight | 725.16 g/mol |
| Exact Mass | 723.25 |
| IUPAC Name | N,5-bis(3-chloro-4-fluorophenyl)-3-[6-(1,2,3,4,6,7,8,9-octahydroquinolizin-9a-yl)hexylimino]phenazin-2-amine;hydrochloride |
| SMILES | Cl.Fc1ccc(Nc2cc3nc4ccccc4n(-c4ccc(F)c(Cl)c4)c-3c/c2=N\CCCCCCC23CCCCN2CCCC3)cc1Cl |
| InChI | InChI=1S/C39H41Cl2F2N5.ClH/c40-29-23-27(13-15-31(29)42)45-35-25-36-38(48(28-14-16-32(43)30(41)24-28)37-12-4-3-11-33(37)46-36)26-34(35)44-20-8-2-1-5-17-39-18-6-9-21-47(39)22-10-7-19-39;/h3-4,11-16,23-26,45H,1-2,5-10,17-22H2;1H/b44-34+; |
| InChIKey | DWFRONFEKYJYDY-AOQHLPNQSA-N |
| XLogP | 11.14 |
| TPSA | 45.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.16 |
| LogP ≤ 5 | 11.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|