C20H36O2 — CID 118721520
3-methyl-2-[(3R,7R)-3,7,11-trimethyldodecyl]-2H-furan-5-one (PubChem CID 118721520) has the molecular formula C20H36O2 and a molecular weight of 308.51 g/mol. Its IUPAC name is 3-methyl-2-[(3R,7R)-3,7,11-trimethyldodecyl]-2H-furan-5-one.
| Compound Name | 3-methyl-2-[(3R,7R)-3,7,11-trimethyldodecyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 118721520 |
| Molecular Formula | C20H36O2 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.27 |
| IUPAC Name | 3-methyl-2-[(3R,7R)-3,7,11-trimethyldodecyl]-2H-furan-5-one |
| SMILES | CC1=CC(=O)OC1CC[C@H](C)CCC[C@H](C)CCCC(C)C |
| InChI | InChI=1S/C20H36O2/c1-15(2)8-6-9-16(3)10-7-11-17(4)12-13-19-18(5)14-20(21)22-19/h14-17,19H,6-13H2,1-5H3/t16-,17-,19?/m1/s1 |
| InChIKey | JSFGMLXYFVQJCV-QNZPCDNOSA-N |
| XLogP | 5.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |