C23H24F3N3O5 — CID 118721527
2-[(5R)-4-[2-(3-propan-2-yloxycarbonylphenyl)acetyl]-8-(trifluoromethyl)-1,2,3,5-tetrahydropyrido[2,3-e][1,4]diazepin-5-yl]acetic acid (PubChem CID 118721527) has the molecular formula C23H24F3N3O5 and a molecular weight of 479.46 g/mol. Its IUPAC name is 2-[(5R)-4-[2-(3-propan-2-yloxycarbonylphenyl)acetyl]-8-(trifluoromethyl)-1,2,3,5-tetrahydropyrido[2,3-e][1,4]diazepin-5-yl]acetic acid.
| Compound Name | 2-[(5R)-4-[2-(3-propan-2-yloxycarbonylphenyl)acetyl]-8-(trifluoromethyl)-1,2,3,5-tetrahydropyrido[2,3-e][1,4]diazepin-5-yl]acetic acid |
|---|---|
| PubChem CID | 118721527 |
| Molecular Formula | C23H24F3N3O5 |
| Molecular Weight | 479.46 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | 2-[(5R)-4-[2-(3-propan-2-yloxycarbonylphenyl)acetyl]-8-(trifluoromethyl)-1,2,3,5-tetrahydropyrido[2,3-e][1,4]diazepin-5-yl]acetic acid |
| SMILES | CC(C)OC(=O)c1cccc(CC(=O)N2CCNc3nc(C(F)(F)F)ccc3[C@H]2CC(=O)O)c1 |
| InChI | InChI=1S/C23H24F3N3O5/c1-13(2)34-22(33)15-5-3-4-14(10-15)11-19(30)29-9-8-27-21-16(17(29)12-20(31)32)6-7-18(28-21)23(24,25)26/h3-7,10,13,17H,8-9,11-12H2,1-2H3,(H,27,28)(H,31,32)/t17-/m1/s1 |
| InChIKey | XZLFUVLTQKFWJP-QGZVFWFLSA-N |
| XLogP | 3.68 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.46 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |