C26H41NO4 — CID 118721566
(1R,2R,4S,9R,10S,13S,16R)-14-[(cyclohexylamino)methyl]-2,16-dihydroxy-5,5,9-trimethyltetracyclo[11.2.1.01,10.04,9]hexadecane-6,15-dione (PubChem CID 118721566) has the molecular formula C26H41NO4 and a molecular weight of 431.62 g/mol. Its IUPAC name is (1R,2R,4S,9R,10S,13S,16R)-14-[(cyclohexylamino)methyl]-2,16-dihydroxy-5,5,9-trimethyltetracyclo[11.2.1.01,10.04,9]hexadecane-6,15-dione.
| Compound Name | (1R,2R,4S,9R,10S,13S,16R)-14-[(cyclohexylamino)methyl]-2,16-dihydroxy-5,5,9-trimethyltetracyclo[11.2.1.01,10.04,9]hexadecane-6,15-dione |
|---|---|
| PubChem CID | 118721566 |
| Molecular Formula | C26H41NO4 |
| Molecular Weight | 431.62 g/mol |
| Exact Mass | 431.30 |
| IUPAC Name | (1R,2R,4S,9R,10S,13S,16R)-14-[(cyclohexylamino)methyl]-2,16-dihydroxy-5,5,9-trimethyltetracyclo[11.2.1.01,10.04,9]hexadecane-6,15-dione |
| SMILES | CC1(C)C(=O)CC[C@]2(C)[C@@H]1C[C@@H](O)[C@]13C(=O)C(CNC4CCCCC4)[C@H](CC[C@@H]21)[C@H]3O |
| InChI | InChI=1S/C26H41NO4/c1-24(2)19-13-21(29)26-18(25(19,3)12-11-20(24)28)10-9-16(22(26)30)17(23(26)31)14-27-15-7-5-4-6-8-15/h15-19,21-22,27,29-30H,4-14H2,1-3H3/t16-,17?,18-,19+,21+,22+,25-,26+/m0/s1 |
| InChIKey | XUAURMNBGCAXJQ-IMLJQXPSSA-N |
| XLogP | 3.26 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.62 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |