C25H22O7S — CID 118721728
(9bR)-2-acetyl-6-(2-benzylsulfanylacetyl)-3,7,9-trihydroxy-8,9b-dimethyldibenzofuran-1-one (PubChem CID 118721728) has the molecular formula C25H22O7S and a molecular weight of 466.51 g/mol. Its IUPAC name is (9bR)-2-acetyl-6-(2-benzylsulfanylacetyl)-3,7,9-trihydroxy-8,9b-dimethyldibenzofuran-1-one.
| Compound Name | (9bR)-2-acetyl-6-(2-benzylsulfanylacetyl)-3,7,9-trihydroxy-8,9b-dimethyldibenzofuran-1-one |
|---|---|
| PubChem CID | 118721728 |
| Molecular Formula | C25H22O7S |
| Molecular Weight | 466.51 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | (9bR)-2-acetyl-6-(2-benzylsulfanylacetyl)-3,7,9-trihydroxy-8,9b-dimethyldibenzofuran-1-one |
| SMILES | CC(=O)C1=C(O)C=C2Oc3c(C(=O)CSCc4ccccc4)c(O)c(C)c(O)c3[C@@]2(C)C1=O |
| InChI | InChI=1S/C25H22O7S/c1-12-21(29)19(16(28)11-33-10-14-7-5-4-6-8-14)23-20(22(12)30)25(3)17(32-23)9-15(27)18(13(2)26)24(25)31/h4-9,27,29-30H,10-11H2,1-3H3/t25-/m0/s1 |
| InChIKey | DTOGHAGDSJCKHP-VWLOTQADSA-N |
| XLogP | 4.04 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.51 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|