C16H28NO2+ — CID 11872182
[(1R,2S,5S,9S)-2-piperidin-1-ium-1-yl-9-bicyclo[3.3.1]nonanyl] acetate (PubChem CID 11872182) has the molecular formula C16H28NO2+ and a molecular weight of 266.40 g/mol. Its IUPAC name is [(1R,2S,5S,9S)-2-piperidin-1-ium-1-yl-9-bicyclo[3.3.1]nonanyl] acetate.
| Compound Name | [(1R,2S,5S,9S)-2-piperidin-1-ium-1-yl-9-bicyclo[3.3.1]nonanyl] acetate |
|---|---|
| PubChem CID | 11872182 |
| Molecular Formula | C16H28NO2+ |
| Molecular Weight | 266.40 g/mol |
| Exact Mass | 266.21 |
| IUPAC Name | [(1R,2S,5S,9S)-2-piperidin-1-ium-1-yl-9-bicyclo[3.3.1]nonanyl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H]2CCC[C@@H]1[C@@H]([NH+]1CCCCC1)CC2 |
| InChI | InChI=1S/C16H27NO2/c1-12(18)19-16-13-6-5-7-14(16)15(9-8-13)17-10-3-2-4-11-17/h13-16H,2-11H2,1H3/p+1/t13-,14+,15-,16-/m0/s1 |
| InChIKey | KSJDJOYKEJTGAN-FZKCQIBNSA-O |
| XLogP | 1.57 |
| TPSA | 30.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.40 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |