About N-(6-pyrido[2,3-b]pyrazin-7-yl-1,3-benzothiazol-2-yl)acetamide
N-(6-pyrido[2,3-b]pyrazin-7-yl-1,3-benzothiazol-2-yl)acetamide (PubChem CID 118721836) has the molecular formula C16H11N5OS
and a molecular weight of 321.37 g/mol. Its IUPAC name is N-(6-pyrido[2,3-b]pyrazin-7-yl-1,3-benzothiazol-2-yl)acetamide.
Molecular Properties
| Compound Name | N-(6-pyrido[2,3-b]pyrazin-7-yl-1,3-benzothiazol-2-yl)acetamide |
| PubChem CID | 118721836 |
| Molecular Formula | C16H11N5OS |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | N-(6-pyrido[2,3-b]pyrazin-7-yl-1,3-benzothiazol-2-yl)acetamide |
| SMILES | CC(=O)Nc1nc2ccc(-c3cnc4nccnc4c3)cc2s1 |
| InChI | InChI=1S/C16H11N5OS/c1-9(22)20-16-21-12-3-2-10(7-14(12)23-16)11-6-13-15(19-8-11)18-5-4-17-13/h2-8H,1H3,(H,20,21,22) |
| InChIKey | WBLTUPGQADTMQO-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 80.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(6-pyrido[2,3-b]pyrazin-7-yl-1,3-benzothiazol-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-pyrido[2,3-b]pyrazin-7-yl-1,3-benzothiazol-2-yl)acetamide?
The IUPAC name of N-(6-pyrido[2,3-b]pyrazin-7-yl-1,3-benzothiazol-2-yl)acetamide (CID 118721836) is N-(6-pyrido[2,3-b]pyrazin-7-yl-1,3-benzothiazol-2-yl)acetamide.
What is the SMILES notation for N-(6-pyrido[2,3-b]pyrazin-7-yl-1,3-benzothiazol-2-yl)acetamide?
The canonical SMILES for N-(6-pyrido[2,3-b]pyrazin-7-yl-1,3-benzothiazol-2-yl)acetamide is CC(=O)Nc1nc2ccc(-c3cnc4nccnc4c3)cc2s1.
What is the InChIKey of N-(6-pyrido[2,3-b]pyrazin-7-yl-1,3-benzothiazol-2-yl)acetamide?
The InChIKey is WBLTUPGQADTMQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11N5OS/c1-9(22)20-16-21-12-3-2-10(7-14(12)23-16)11-6-13-15(19-8-11)18-5-4-17-13/h2-8H,1H3,(H,20,21,22).
What are the key properties of N-(6-pyrido[2,3-b]pyrazin-7-yl-1,3-benzothiazol-2-yl)acetamide?
N-(6-pyrido[2,3-b]pyrazin-7-yl-1,3-benzothiazol-2-yl)acetamide has a molecular weight of 321.37 g/mol, XLogP of 3.26, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-pyrido[2,3-b]pyrazin-7-yl-1,3-benzothiazol-2-yl)acetamide is sourced from PubChem (CID 118721836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).