About benzyl 4-[bis(1,3-benzodioxol-5-yl)-hydroxymethyl]piperidine-1-carboxylate
benzyl 4-[bis(1,3-benzodioxol-5-yl)-hydroxymethyl]piperidine-1-carboxylate (PubChem CID 118721894) has the molecular formula C28H27NO7
and a molecular weight of 489.52 g/mol. Its IUPAC name is benzyl 4-[bis(1,3-benzodioxol-5-yl)-hydroxymethyl]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | benzyl 4-[bis(1,3-benzodioxol-5-yl)-hydroxymethyl]piperidine-1-carboxylate |
| PubChem CID | 118721894 |
| Molecular Formula | C28H27NO7 |
| Molecular Weight | 489.52 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | benzyl 4-[bis(1,3-benzodioxol-5-yl)-hydroxymethyl]piperidine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCC(C(O)(c2ccc3c(c2)OCO3)c2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C28H27NO7/c30-27(32-16-19-4-2-1-3-5-19)29-12-10-20(11-13-29)28(31,21-6-8-23-25(14-21)35-17-33-23)22-7-9-24-26(15-22)36-18-34-24/h1-9,14-15,20,31H,10-13,16-18H2 |
| InChIKey | BUKZPULTUFEPFI-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 489.52 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze benzyl 4-[bis(1,3-benzodioxol-5-yl)-hydroxymethyl]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 4-[bis(1,3-benzodioxol-5-yl)-hydroxymethyl]piperidine-1-carboxylate?
The IUPAC name of benzyl 4-[bis(1,3-benzodioxol-5-yl)-hydroxymethyl]piperidine-1-carboxylate (CID 118721894) is benzyl 4-[bis(1,3-benzodioxol-5-yl)-hydroxymethyl]piperidine-1-carboxylate.
What is the SMILES notation for benzyl 4-[bis(1,3-benzodioxol-5-yl)-hydroxymethyl]piperidine-1-carboxylate?
The canonical SMILES for benzyl 4-[bis(1,3-benzodioxol-5-yl)-hydroxymethyl]piperidine-1-carboxylate is O=C(OCc1ccccc1)N1CCC(C(O)(c2ccc3c(c2)OCO3)c2ccc3c(c2)OCO3)CC1.
What is the InChIKey of benzyl 4-[bis(1,3-benzodioxol-5-yl)-hydroxymethyl]piperidine-1-carboxylate?
The InChIKey is BUKZPULTUFEPFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H27NO7/c30-27(32-16-19-4-2-1-3-5-19)29-12-10-20(11-13-29)28(31,21-6-8-23-25(14-21)35-17-33-23)22-7-9-24-26(15-22)36-18-34-24/h1-9,14-15,20,31H,10-13,16-18H2.
What are the key properties of benzyl 4-[bis(1,3-benzodioxol-5-yl)-hydroxymethyl]piperidine-1-carboxylate?
benzyl 4-[bis(1,3-benzodioxol-5-yl)-hydroxymethyl]piperidine-1-carboxylate has a molecular weight of 489.52 g/mol, XLogP of 4.43, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 4-[bis(1,3-benzodioxol-5-yl)-hydroxymethyl]piperidine-1-carboxylate is sourced from PubChem (CID 118721894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).