C23H22Cl3NO7 — CID 118721895
2,2,2-trichloroethyl 4-[bis(1,3-benzodioxol-5-yl)-hydroxymethyl]piperidine-1-carboxylate (PubChem CID 118721895) has the molecular formula C23H22Cl3NO7 and a molecular weight of 530.79 g/mol. Its IUPAC name is 2,2,2-trichloroethyl 4-[bis(1,3-benzodioxol-5-yl)-hydroxymethyl]piperidine-1-carboxylate.
| Compound Name | 2,2,2-trichloroethyl 4-[bis(1,3-benzodioxol-5-yl)-hydroxymethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 118721895 |
| Molecular Formula | C23H22Cl3NO7 |
| Molecular Weight | 530.79 g/mol |
| Exact Mass | 529.05 |
| IUPAC Name | 2,2,2-trichloroethyl 4-[bis(1,3-benzodioxol-5-yl)-hydroxymethyl]piperidine-1-carboxylate |
| SMILES | O=C(OCC(Cl)(Cl)Cl)N1CCC(C(O)(c2ccc3c(c2)OCO3)c2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C23H22Cl3NO7/c24-22(25,26)11-30-21(28)27-7-5-14(6-8-27)23(29,15-1-3-17-19(9-15)33-12-31-17)16-2-4-18-20(10-16)34-13-32-18/h1-4,9-10,14,29H,5-8,11-13H2 |
| InChIKey | BVOYVEQDOMCEQH-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.79 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|