About 3-chloro-4-[4-[(2S)-1,1,1-trifluoro-2-hydroxypropan-2-yl]phenyl]sulfonyl(14C)benzonitrile
3-chloro-4-[4-[(2S)-1,1,1-trifluoro-2-hydroxypropan-2-yl]phenyl]sulfonyl(14C)benzonitrile (PubChem CID 118721947) has the molecular formula C16H11ClF3NO3S
and a molecular weight of 391.77 g/mol. Its IUPAC name is 3-chloro-4-[4-[(2S)-1,1,1-trifluoro-2-hydroxypropan-2-yl]phenyl]sulfonyl(14C)benzonitrile.
Molecular Properties
| Compound Name | 3-chloro-4-[4-[(2S)-1,1,1-trifluoro-2-hydroxypropan-2-yl]phenyl]sulfonyl(14C)benzonitrile |
| PubChem CID | 118721947 |
| Molecular Formula | C16H11ClF3NO3S |
| Molecular Weight | 391.77 g/mol |
| Exact Mass | 391.01 |
| IUPAC Name | 3-chloro-4-[4-[(2S)-1,1,1-trifluoro-2-hydroxypropan-2-yl]phenyl]sulfonyl(14C)benzonitrile |
| SMILES | C[C@](O)(c1ccc(S(=O)(=O)c2ccc([14C]#N)cc2Cl)cc1)C(F)(F)F |
| InChI | InChI=1S/C16H11ClF3NO3S/c1-15(22,16(18,19)20)11-3-5-12(6-4-11)25(23,24)14-7-2-10(9-21)8-13(14)17/h2-8,22H,1H3/t15-/m0/s1/i9+2 |
| InChIKey | UMQOWWADXICFNS-JORHSSIFSA-N |
| XLogP | 3.81 |
| TPSA | 78.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.77 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-chloro-4-[4-[(2S)-1,1,1-trifluoro-2-hydroxypropan-2-yl]phenyl]sulfonyl(14C)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-4-[4-[(2S)-1,1,1-trifluoro-2-hydroxypropan-2-yl]phenyl]sulfonyl(14C)benzonitrile?
The IUPAC name of 3-chloro-4-[4-[(2S)-1,1,1-trifluoro-2-hydroxypropan-2-yl]phenyl]sulfonyl(14C)benzonitrile (CID 118721947) is 3-chloro-4-[4-[(2S)-1,1,1-trifluoro-2-hydroxypropan-2-yl]phenyl]sulfonyl(14C)benzonitrile.
What is the SMILES notation for 3-chloro-4-[4-[(2S)-1,1,1-trifluoro-2-hydroxypropan-2-yl]phenyl]sulfonyl(14C)benzonitrile?
The canonical SMILES for 3-chloro-4-[4-[(2S)-1,1,1-trifluoro-2-hydroxypropan-2-yl]phenyl]sulfonyl(14C)benzonitrile is C[C@](O)(c1ccc(S(=O)(=O)c2ccc([14C]#N)cc2Cl)cc1)C(F)(F)F.
What is the InChIKey of 3-chloro-4-[4-[(2S)-1,1,1-trifluoro-2-hydroxypropan-2-yl]phenyl]sulfonyl(14C)benzonitrile?
The InChIKey is UMQOWWADXICFNS-JORHSSIFSA-N. The full InChI is InChI=1S/C16H11ClF3NO3S/c1-15(22,16(18,19)20)11-3-5-12(6-4-11)25(23,24)14-7-2-10(9-21)8-13(14)17/h2-8,22H,1H3/t15-/m0/s1/i9+2.
What are the key properties of 3-chloro-4-[4-[(2S)-1,1,1-trifluoro-2-hydroxypropan-2-yl]phenyl]sulfonyl(14C)benzonitrile?
3-chloro-4-[4-[(2S)-1,1,1-trifluoro-2-hydroxypropan-2-yl]phenyl]sulfonyl(14C)benzonitrile has a molecular weight of 391.77 g/mol, XLogP of 3.81, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-4-[4-[(2S)-1,1,1-trifluoro-2-hydroxypropan-2-yl]phenyl]sulfonyl(14C)benzonitrile is sourced from PubChem (CID 118721947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).