C25H36N4O4 — CID 118722033
(3R,4R,5S)-4-acetamido-5-amino-N-[3-(1H-indol-2-yl)propoxy]-3-pentan-3-yloxycyclohexene-1-carboxamide (PubChem CID 118722033) has the molecular formula C25H36N4O4 and a molecular weight of 456.59 g/mol. Its IUPAC name is (3R,4R,5S)-4-acetamido-5-amino-N-[3-(1H-indol-2-yl)propoxy]-3-pentan-3-yloxycyclohexene-1-carboxamide.
| Compound Name | (3R,4R,5S)-4-acetamido-5-amino-N-[3-(1H-indol-2-yl)propoxy]-3-pentan-3-yloxycyclohexene-1-carboxamide |
|---|---|
| PubChem CID | 118722033 |
| Molecular Formula | C25H36N4O4 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.27 |
| IUPAC Name | (3R,4R,5S)-4-acetamido-5-amino-N-[3-(1H-indol-2-yl)propoxy]-3-pentan-3-yloxycyclohexene-1-carboxamide |
| SMILES | CCC(CC)O[C@@H]1C=C(C(=O)NOCCCc2cc3ccccc3[nH]2)C[C@H](N)[C@H]1NC(C)=O |
| InChI | InChI=1S/C25H36N4O4/c1-4-20(5-2)33-23-15-18(14-21(26)24(23)27-16(3)30)25(31)29-32-12-8-10-19-13-17-9-6-7-11-22(17)28-19/h6-7,9,11,13,15,20-21,23-24,28H,4-5,8,10,12,14,26H2,1-3H3,(H,27,30)(H,29,31)/t21-,23+,24+/m0/s1 |
| InChIKey | NVEHHLIUGKSLBV-QPTUXGOLSA-N |
| XLogP | 2.88 |
| TPSA | 118.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|