About N-benzyl-4,5-dihydro-1H-imidazol-2-amine;hydrochloride
N-benzyl-4,5-dihydro-1H-imidazol-2-amine;hydrochloride (PubChem CID 118722127) has the molecular formula C10H14ClN3
and a molecular weight of 211.70 g/mol. Its IUPAC name is N-benzyl-4,5-dihydro-1H-imidazol-2-amine;hydrochloride.
Molecular Properties
| Compound Name | N-benzyl-4,5-dihydro-1H-imidazol-2-amine;hydrochloride |
| PubChem CID | 118722127 |
| Molecular Formula | C10H14ClN3 |
| Molecular Weight | 211.70 g/mol |
| Exact Mass | 211.09 |
| IUPAC Name | N-benzyl-4,5-dihydro-1H-imidazol-2-amine;hydrochloride |
| SMILES | Cl.c1ccc(CNC2=NCCN2)cc1 |
| InChI | InChI=1S/C10H13N3.ClH/c1-2-4-9(5-3-1)8-13-10-11-6-7-12-10;/h1-5H,6-8H2,(H2,11,12,13);1H |
| InChIKey | RACKHQPWGCCURG-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.70 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-benzyl-4,5-dihydro-1H-imidazol-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-4,5-dihydro-1H-imidazol-2-amine;hydrochloride?
The IUPAC name of N-benzyl-4,5-dihydro-1H-imidazol-2-amine;hydrochloride (CID 118722127) is N-benzyl-4,5-dihydro-1H-imidazol-2-amine;hydrochloride.
What is the SMILES notation for N-benzyl-4,5-dihydro-1H-imidazol-2-amine;hydrochloride?
The canonical SMILES for N-benzyl-4,5-dihydro-1H-imidazol-2-amine;hydrochloride is Cl.c1ccc(CNC2=NCCN2)cc1.
What is the InChIKey of N-benzyl-4,5-dihydro-1H-imidazol-2-amine;hydrochloride?
The InChIKey is RACKHQPWGCCURG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3.ClH/c1-2-4-9(5-3-1)8-13-10-11-6-7-12-10;/h1-5H,6-8H2,(H2,11,12,13);1H.
What are the key properties of N-benzyl-4,5-dihydro-1H-imidazol-2-amine;hydrochloride?
N-benzyl-4,5-dihydro-1H-imidazol-2-amine;hydrochloride has a molecular weight of 211.70 g/mol, XLogP of 1.16, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-4,5-dihydro-1H-imidazol-2-amine;hydrochloride is sourced from PubChem (CID 118722127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).