About 3-[(3-ethoxycarbonyl-6,8-dimethylquinolin-4-yl)amino]benzoic acid
3-[(3-ethoxycarbonyl-6,8-dimethylquinolin-4-yl)amino]benzoic acid (PubChem CID 1187222) has the molecular formula C21H20N2O4
and a molecular weight of 364.40 g/mol. Its IUPAC name is 3-[(3-ethoxycarbonyl-6,8-dimethylquinolin-4-yl)amino]benzoic acid.
Molecular Properties
| Compound Name | 3-[(3-ethoxycarbonyl-6,8-dimethylquinolin-4-yl)amino]benzoic acid |
| PubChem CID | 1187222 |
| Molecular Formula | C21H20N2O4 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 3-[(3-ethoxycarbonyl-6,8-dimethylquinolin-4-yl)amino]benzoic acid |
| SMILES | CCOC(=O)c1cnc2c(C)cc(C)cc2c1Nc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C21H20N2O4/c1-4-27-21(26)17-11-22-18-13(3)8-12(2)9-16(18)19(17)23-15-7-5-6-14(10-15)20(24)25/h5-11H,4H2,1-3H3,(H,22,23)(H,24,25) |
| InChIKey | DWGVYYCRFPJJQG-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(3-ethoxycarbonyl-6,8-dimethylquinolin-4-yl)amino]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3-ethoxycarbonyl-6,8-dimethylquinolin-4-yl)amino]benzoic acid?
The IUPAC name of 3-[(3-ethoxycarbonyl-6,8-dimethylquinolin-4-yl)amino]benzoic acid (CID 1187222) is 3-[(3-ethoxycarbonyl-6,8-dimethylquinolin-4-yl)amino]benzoic acid.
What is the SMILES notation for 3-[(3-ethoxycarbonyl-6,8-dimethylquinolin-4-yl)amino]benzoic acid?
The canonical SMILES for 3-[(3-ethoxycarbonyl-6,8-dimethylquinolin-4-yl)amino]benzoic acid is CCOC(=O)c1cnc2c(C)cc(C)cc2c1Nc1cccc(C(=O)O)c1.
What is the InChIKey of 3-[(3-ethoxycarbonyl-6,8-dimethylquinolin-4-yl)amino]benzoic acid?
The InChIKey is DWGVYYCRFPJJQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N2O4/c1-4-27-21(26)17-11-22-18-13(3)8-12(2)9-16(18)19(17)23-15-7-5-6-14(10-15)20(24)25/h5-11H,4H2,1-3H3,(H,22,23)(H,24,25).
What are the key properties of 3-[(3-ethoxycarbonyl-6,8-dimethylquinolin-4-yl)amino]benzoic acid?
3-[(3-ethoxycarbonyl-6,8-dimethylquinolin-4-yl)amino]benzoic acid has a molecular weight of 364.40 g/mol, XLogP of 4.47, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3-ethoxycarbonyl-6,8-dimethylquinolin-4-yl)amino]benzoic acid is sourced from PubChem (CID 1187222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).